About 6-amino-1-(3,3-difluoropyrrolidin-1-yl)hexan-1-one
6-amino-1-(3,3-difluoropyrrolidin-1-yl)hexan-1-one (PubChem CID 91367577) has the molecular formula C10H18F2N2O
and a molecular weight of 220.26 g/mol. Its IUPAC name is 6-amino-1-(3,3-difluoropyrrolidin-1-yl)hexan-1-one.
Molecular Properties
| Compound Name | 6-amino-1-(3,3-difluoropyrrolidin-1-yl)hexan-1-one |
| PubChem CID | 91367577 |
| Molecular Formula | C10H18F2N2O |
| Molecular Weight | 220.26 g/mol |
| Exact Mass | 220.14 |
| IUPAC Name | 6-amino-1-(3,3-difluoropyrrolidin-1-yl)hexan-1-one |
| SMILES | NCCCCCC(=O)N1CCC(F)(F)C1 |
| InChI | InChI=1S/C10H18F2N2O/c11-10(12)5-7-14(8-10)9(15)4-2-1-3-6-13/h1-8,13H2 |
| InChIKey | HZVJYBXVLQLFDT-UHFFFAOYSA-N |
| XLogP | 1.37 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 220.26 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 6-amino-1-(3,3-difluoropyrrolidin-1-yl)hexan-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-amino-1-(3,3-difluoropyrrolidin-1-yl)hexan-1-one?
The IUPAC name of 6-amino-1-(3,3-difluoropyrrolidin-1-yl)hexan-1-one (CID 91367577) is 6-amino-1-(3,3-difluoropyrrolidin-1-yl)hexan-1-one.
What is the SMILES notation for 6-amino-1-(3,3-difluoropyrrolidin-1-yl)hexan-1-one?
The canonical SMILES for 6-amino-1-(3,3-difluoropyrrolidin-1-yl)hexan-1-one is NCCCCCC(=O)N1CCC(F)(F)C1.
What is the InChIKey of 6-amino-1-(3,3-difluoropyrrolidin-1-yl)hexan-1-one?
The InChIKey is HZVJYBXVLQLFDT-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H18F2N2O/c11-10(12)5-7-14(8-10)9(15)4-2-1-3-6-13/h1-8,13H2.
What are the key properties of 6-amino-1-(3,3-difluoropyrrolidin-1-yl)hexan-1-one?
6-amino-1-(3,3-difluoropyrrolidin-1-yl)hexan-1-one has a molecular weight of 220.26 g/mol, XLogP of 1.37, 5 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 6-amino-1-(3,3-difluoropyrrolidin-1-yl)hexan-1-one is sourced from PubChem (CID 91367577), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).