About 4-bromododec-11-ene-1,10-diol
4-bromododec-11-ene-1,10-diol (PubChem CID 91368152) has the molecular formula C12H23BrO2
and a molecular weight of 279.22 g/mol. Its IUPAC name is 4-bromododec-11-ene-1,10-diol.
Molecular Properties
| Compound Name | 4-bromododec-11-ene-1,10-diol |
| PubChem CID | 91368152 |
| Molecular Formula | C12H23BrO2 |
| Molecular Weight | 279.22 g/mol |
| Exact Mass | 278.09 |
| IUPAC Name | 4-bromododec-11-ene-1,10-diol |
| SMILES | C=CC(O)CCCCCC(Br)CCCO |
| InChI | InChI=1S/C12H23BrO2/c1-2-12(15)9-5-3-4-7-11(13)8-6-10-14/h2,11-12,14-15H,1,3-10H2 |
| InChIKey | DGGIAFOGNHEXMY-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 279.22 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 4-bromododec-11-ene-1,10-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-bromododec-11-ene-1,10-diol?
The IUPAC name of 4-bromododec-11-ene-1,10-diol (CID 91368152) is 4-bromododec-11-ene-1,10-diol.
What is the SMILES notation for 4-bromododec-11-ene-1,10-diol?
The canonical SMILES for 4-bromododec-11-ene-1,10-diol is C=CC(O)CCCCCC(Br)CCCO.
What is the InChIKey of 4-bromododec-11-ene-1,10-diol?
The InChIKey is DGGIAFOGNHEXMY-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H23BrO2/c1-2-12(15)9-5-3-4-7-11(13)8-6-10-14/h2,11-12,14-15H,1,3-10H2.
What are the key properties of 4-bromododec-11-ene-1,10-diol?
4-bromododec-11-ene-1,10-diol has a molecular weight of 279.22 g/mol, XLogP of 3.02, 10 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-bromododec-11-ene-1,10-diol is sourced from PubChem (CID 91368152), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).