C24H31N2O2+ — CID 91368246
5,5-dimethyl-1,1-bis(2,4,6-trimethylphenyl)-1,3-diazinan-1-ium-4,6-dione (PubChem CID 91368246) has the molecular formula C24H31N2O2+ and a molecular weight of 379.52 g/mol. Its IUPAC name is 5,5-dimethyl-1,1-bis(2,4,6-trimethylphenyl)-1,3-diazinan-1-ium-4,6-dione.
| Compound Name | 5,5-dimethyl-1,1-bis(2,4,6-trimethylphenyl)-1,3-diazinan-1-ium-4,6-dione |
|---|---|
| PubChem CID | 91368246 |
| Molecular Formula | C24H31N2O2+ |
| Molecular Weight | 379.52 g/mol |
| Exact Mass | 379.24 |
| IUPAC Name | 5,5-dimethyl-1,1-bis(2,4,6-trimethylphenyl)-1,3-diazinan-1-ium-4,6-dione |
| SMILES | Cc1cc(C)c([N+]2(c3c(C)cc(C)cc3C)CNC(=O)C(C)(C)C2=O)c(C)c1 |
| InChI | InChI=1S/C24H30N2O2/c1-14-9-16(3)20(17(4)10-14)26(13-25-22(27)24(7,8)23(26)28)21-18(5)11-15(2)12-19(21)6/h9-12H,13H2,1-8H3/p+1 |
| InChIKey | VGUNKHVYSDOWGU-UHFFFAOYSA-O |
| XLogP | 4.82 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.52 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|