About 2-(4-aminophenyl)-5,6-dihydro-1H-pyrrolo[3,2-b]pyridin-5-amine
2-(4-aminophenyl)-5,6-dihydro-1H-pyrrolo[3,2-b]pyridin-5-amine (PubChem CID 91368267) has the molecular formula C13H14N4
and a molecular weight of 226.28 g/mol. Its IUPAC name is 2-(4-aminophenyl)-5,6-dihydro-1H-pyrrolo[3,2-b]pyridin-5-amine.
Molecular Properties
| Compound Name | 2-(4-aminophenyl)-5,6-dihydro-1H-pyrrolo[3,2-b]pyridin-5-amine |
| PubChem CID | 91368267 |
| Molecular Formula | C13H14N4 |
| Molecular Weight | 226.28 g/mol |
| Exact Mass | 226.12 |
| IUPAC Name | 2-(4-aminophenyl)-5,6-dihydro-1H-pyrrolo[3,2-b]pyridin-5-amine |
| SMILES | Nc1ccc(-c2cc3c([nH]2)=CCC(N)N=3)cc1 |
| InChI | InChI=1S/C13H14N4/c14-9-3-1-8(2-4-9)11-7-12-10(16-11)5-6-13(15)17-12/h1-5,7,13,16H,6,14-15H2 |
| InChIKey | NYWKZCNIYGNONA-UHFFFAOYSA-N |
| XLogP | 0.35 |
| TPSA | 80.19 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 226.28 |
| LogP ≤ 5 | 0.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 2-(4-aminophenyl)-5,6-dihydro-1H-pyrrolo[3,2-b]pyridin-5-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(4-aminophenyl)-5,6-dihydro-1H-pyrrolo[3,2-b]pyridin-5-amine?
The IUPAC name of 2-(4-aminophenyl)-5,6-dihydro-1H-pyrrolo[3,2-b]pyridin-5-amine (CID 91368267) is 2-(4-aminophenyl)-5,6-dihydro-1H-pyrrolo[3,2-b]pyridin-5-amine.
What is the SMILES notation for 2-(4-aminophenyl)-5,6-dihydro-1H-pyrrolo[3,2-b]pyridin-5-amine?
The canonical SMILES for 2-(4-aminophenyl)-5,6-dihydro-1H-pyrrolo[3,2-b]pyridin-5-amine is Nc1ccc(-c2cc3c([nH]2)=CCC(N)N=3)cc1.
What is the InChIKey of 2-(4-aminophenyl)-5,6-dihydro-1H-pyrrolo[3,2-b]pyridin-5-amine?
The InChIKey is NYWKZCNIYGNONA-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H14N4/c14-9-3-1-8(2-4-9)11-7-12-10(16-11)5-6-13(15)17-12/h1-5,7,13,16H,6,14-15H2.
What are the key properties of 2-(4-aminophenyl)-5,6-dihydro-1H-pyrrolo[3,2-b]pyridin-5-amine?
2-(4-aminophenyl)-5,6-dihydro-1H-pyrrolo[3,2-b]pyridin-5-amine has a molecular weight of 226.28 g/mol, XLogP of 0.35, 1 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(4-aminophenyl)-5,6-dihydro-1H-pyrrolo[3,2-b]pyridin-5-amine is sourced from PubChem (CID 91368267), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).