C17H25F2N3O5S — CID 91369034
2-[4-(4,4-difluoropiperidin-1-yl)-6-[(2-methylpropan-2-yl)oxycarbonylamino]-2-pyridinyl]ethanesulfonic acid (PubChem CID 91369034) has the molecular formula C17H25F2N3O5S and a molecular weight of 421.47 g/mol. Its IUPAC name is 2-[4-(4,4-difluoropiperidin-1-yl)-6-[(2-methylpropan-2-yl)oxycarbonylamino]-2-pyridinyl]ethanesulfonic acid.
| Compound Name | 2-[4-(4,4-difluoropiperidin-1-yl)-6-[(2-methylpropan-2-yl)oxycarbonylamino]-2-pyridinyl]ethanesulfonic acid |
|---|---|
| PubChem CID | 91369034 |
| Molecular Formula | C17H25F2N3O5S |
| Molecular Weight | 421.47 g/mol |
| Exact Mass | 421.15 |
| IUPAC Name | 2-[4-(4,4-difluoropiperidin-1-yl)-6-[(2-methylpropan-2-yl)oxycarbonylamino]-2-pyridinyl]ethanesulfonic acid |
| SMILES | CC(C)(C)OC(=O)Nc1cc(N2CCC(F)(F)CC2)cc(CCS(=O)(=O)O)n1 |
| InChI | InChI=1S/C17H25F2N3O5S/c1-16(2,3)27-15(23)21-14-11-13(22-7-5-17(18,19)6-8-22)10-12(20-14)4-9-28(24,25)26/h10-11H,4-9H2,1-3H3,(H,20,21,23)(H,24,25,26) |
| InChIKey | FUPPHXCSWHWDCO-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 108.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.47 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|