About 2-[5-[2-(ethylamino)ethoxy]-3-pyridinyl]-8,9-dimethoxybenzo[c][2,7]naphthyridin-5-amine
2-[5-[2-(ethylamino)ethoxy]-3-pyridinyl]-8,9-dimethoxybenzo[c][2,7]naphthyridin-5-amine (PubChem CID 91369350) has the molecular formula C23H25N5O3
and a molecular weight of 419.49 g/mol. Its IUPAC name is 2-[5-[2-(ethylamino)ethoxy]-3-pyridinyl]-8,9-dimethoxybenzo[c][2,7]naphthyridin-5-amine.
Molecular Properties
| Compound Name | 2-[5-[2-(ethylamino)ethoxy]-3-pyridinyl]-8,9-dimethoxybenzo[c][2,7]naphthyridin-5-amine |
| PubChem CID | 91369350 |
| Molecular Formula | C23H25N5O3 |
| Molecular Weight | 419.49 g/mol |
| Exact Mass | 419.20 |
| IUPAC Name | 2-[5-[2-(ethylamino)ethoxy]-3-pyridinyl]-8,9-dimethoxybenzo[c][2,7]naphthyridin-5-amine |
| SMILES | CCNCCOc1cncc(-c2cc3c(cn2)c(N)nc2cc(OC)c(OC)cc23)c1 |
| InChI | InChI=1S/C23H25N5O3/c1-4-25-5-6-31-15-7-14(11-26-12-15)19-8-16-17-9-21(29-2)22(30-3)10-20(17)28-23(24)18(16)13-27-19/h7-13,25H,4-6H2,1-3H3,(H2,24,28) |
| InChIKey | ATGVEXHAGGYODG-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 104.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 419.49 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|
Analyze 2-[5-[2-(ethylamino)ethoxy]-3-pyridinyl]-8,9-dimethoxybenzo[c][2,7]naphthyridin-5-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[5-[2-(ethylamino)ethoxy]-3-pyridinyl]-8,9-dimethoxybenzo[c][2,7]naphthyridin-5-amine?
The IUPAC name of 2-[5-[2-(ethylamino)ethoxy]-3-pyridinyl]-8,9-dimethoxybenzo[c][2,7]naphthyridin-5-amine (CID 91369350) is 2-[5-[2-(ethylamino)ethoxy]-3-pyridinyl]-8,9-dimethoxybenzo[c][2,7]naphthyridin-5-amine.
What is the SMILES notation for 2-[5-[2-(ethylamino)ethoxy]-3-pyridinyl]-8,9-dimethoxybenzo[c][2,7]naphthyridin-5-amine?
The canonical SMILES for 2-[5-[2-(ethylamino)ethoxy]-3-pyridinyl]-8,9-dimethoxybenzo[c][2,7]naphthyridin-5-amine is CCNCCOc1cncc(-c2cc3c(cn2)c(N)nc2cc(OC)c(OC)cc23)c1.
What is the InChIKey of 2-[5-[2-(ethylamino)ethoxy]-3-pyridinyl]-8,9-dimethoxybenzo[c][2,7]naphthyridin-5-amine?
The InChIKey is ATGVEXHAGGYODG-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H25N5O3/c1-4-25-5-6-31-15-7-14(11-26-12-15)19-8-16-17-9-21(29-2)22(30-3)10-20(17)28-23(24)18(16)13-27-19/h7-13,25H,4-6H2,1-3H3,(H2,24,28).
What are the key properties of 2-[5-[2-(ethylamino)ethoxy]-3-pyridinyl]-8,9-dimethoxybenzo[c][2,7]naphthyridin-5-amine?
2-[5-[2-(ethylamino)ethoxy]-3-pyridinyl]-8,9-dimethoxybenzo[c][2,7]naphthyridin-5-amine has a molecular weight of 419.49 g/mol, XLogP of 3.43, 8 rotatable bonds, 2 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[5-[2-(ethylamino)ethoxy]-3-pyridinyl]-8,9-dimethoxybenzo[c][2,7]naphthyridin-5-amine is sourced from PubChem (CID 91369350), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).