C40H65NO4 — CID 91369388
[(3R)-10,13-dimethyl-17-octan-2-yl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-3-yl] 4-(2,5-dihydroxy-3,4-dimethylpyrrol-1-yl)cyclohexane-1-carboxylate (PubChem CID 91369388) has the molecular formula C40H65NO4 and a molecular weight of 623.96 g/mol. Its IUPAC name is [(3R)-10,13-dimethyl-17-octan-2-yl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-3-yl] 4-(2,5-dihydroxy-3,4-dimethylpyrrol-1-yl)cyclohexane-1-carboxylate.
| Compound Name | [(3R)-10,13-dimethyl-17-octan-2-yl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-3-yl] 4-(2,5-dihydroxy-3,4-dimethylpyrrol-1-yl)cyclohexane-1-carboxylate |
|---|---|
| PubChem CID | 91369388 |
| Molecular Formula | C40H65NO4 |
| Molecular Weight | 623.96 g/mol |
| Exact Mass | 623.49 |
| IUPAC Name | [(3R)-10,13-dimethyl-17-octan-2-yl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-3-yl] 4-(2,5-dihydroxy-3,4-dimethylpyrrol-1-yl)cyclohexane-1-carboxylate |
| SMILES | CCCCCCC(C)C1CCC2C3CCC4C[C@H](OC(=O)C5CCC(n6c(O)c(C)c(C)c6O)CC5)CCC4(C)C3CCC12C |
| InChI | InChI=1S/C40H65NO4/c1-7-8-9-10-11-25(2)33-18-19-34-32-17-14-29-24-31(20-22-39(29,5)35(32)21-23-40(33,34)6)45-38(44)28-12-15-30(16-13-28)41-36(42)26(3)27(4)37(41)43/h25,28-35,42-43H,7-24H2,1-6H3/t25?,28?,29?,30?,31-,32?,33?,34?,35?,39?,40?/m1/s1 |
| InChIKey | AEVBVUBLHVBMIL-XIVMNKHWSA-N |
| XLogP | 10.42 |
| TPSA | 71.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 623.96 |
| LogP ≤ 5 | 10.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|