C20H30O3 — CID 91369568
(1S,2S,5R,6R,8S,11R,13R)-12-(hydroxymethyl)-6,12-dimethyl-14-oxapentacyclo[11.2.2.15,8.01,11.02,8]octadec-16-en-13-ol (PubChem CID 91369568) has the molecular formula C20H30O3 and a molecular weight of 318.46 g/mol. Its IUPAC name is (1S,2S,5R,6R,8S,11R,13R)-12-(hydroxymethyl)-6,12-dimethyl-14-oxapentacyclo[11.2.2.15,8.01,11.02,8]octadec-16-en-13-ol.
| Compound Name | (1S,2S,5R,6R,8S,11R,13R)-12-(hydroxymethyl)-6,12-dimethyl-14-oxapentacyclo[11.2.2.15,8.01,11.02,8]octadec-16-en-13-ol |
|---|---|
| PubChem CID | 91369568 |
| Molecular Formula | C20H30O3 |
| Molecular Weight | 318.46 g/mol |
| Exact Mass | 318.22 |
| IUPAC Name | (1S,2S,5R,6R,8S,11R,13R)-12-(hydroxymethyl)-6,12-dimethyl-14-oxapentacyclo[11.2.2.15,8.01,11.02,8]octadec-16-en-13-ol |
| SMILES | C[C@@H]1C[C@]23CC[C@H]4C(C)(CO)[C@@]5(O)C=C[C@]4(CO5)[C@H]2CC[C@@H]1C3 |
| InChI | InChI=1S/C20H30O3/c1-13-9-18-6-5-15-17(2,11-21)20(22)8-7-19(15,12-23-20)16(18)4-3-14(13)10-18/h7-8,13-16,21-22H,3-6,9-12H2,1-2H3/t13-,14-,15+,16+,17?,18+,19-,20-/m1/s1 |
| InChIKey | JCRUNRYZZTUEIL-BZVYIWBQSA-N |
| XLogP | 3.11 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.46 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|