C26H24ClNO3S — CID 91370093
4-[5-[(4-chloro-1,3-benzothiazol-2-yl)oxy]-2-ethylphenyl]tricyclo[5.2.2.02,6]undecane-3,5-dione (PubChem CID 91370093) has the molecular formula C26H24ClNO3S and a molecular weight of 466.00 g/mol. Its IUPAC name is 4-[5-[(4-chloro-1,3-benzothiazol-2-yl)oxy]-2-ethylphenyl]tricyclo[5.2.2.02,6]undecane-3,5-dione.
| Compound Name | 4-[5-[(4-chloro-1,3-benzothiazol-2-yl)oxy]-2-ethylphenyl]tricyclo[5.2.2.02,6]undecane-3,5-dione |
|---|---|
| PubChem CID | 91370093 |
| Molecular Formula | C26H24ClNO3S |
| Molecular Weight | 466.00 g/mol |
| Exact Mass | 465.12 |
| IUPAC Name | 4-[5-[(4-chloro-1,3-benzothiazol-2-yl)oxy]-2-ethylphenyl]tricyclo[5.2.2.02,6]undecane-3,5-dione |
| SMILES | CCc1ccc(Oc2nc3c(Cl)cccc3s2)cc1C1C(=O)C2C3CCC(CC3)C2C1=O |
| InChI | InChI=1S/C26H24ClNO3S/c1-2-13-10-11-16(31-26-28-23-18(27)4-3-5-19(23)32-26)12-17(13)22-24(29)20-14-6-7-15(9-8-14)21(20)25(22)30/h3-5,10-12,14-15,20-22H,2,6-9H2,1H3 |
| InChIKey | XFOGZIGECYIGNI-UHFFFAOYSA-N |
| XLogP | 6.59 |
| TPSA | 56.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.00 |
| LogP ≤ 5 | 6.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|