C6H12Cl3NOSi — CID 91370094
3-[methoxy(2,2,2-trichloroethylidene)silyl]propan-1-amine (PubChem CID 91370094) has the molecular formula C6H12Cl3NOSi and a molecular weight of 248.61 g/mol. Its IUPAC name is 3-[methoxy(2,2,2-trichloroethylidene)silyl]propan-1-amine.
| Compound Name | 3-[methoxy(2,2,2-trichloroethylidene)silyl]propan-1-amine |
|---|---|
| PubChem CID | 91370094 |
| Molecular Formula | C6H12Cl3NOSi |
| Molecular Weight | 248.61 g/mol |
| Exact Mass | 246.98 |
| IUPAC Name | 3-[methoxy(2,2,2-trichloroethylidene)silyl]propan-1-amine |
| SMILES | CO[Si](=CC(Cl)(Cl)Cl)CCCN |
| InChI | InChI=1S/C6H12Cl3NOSi/c1-11-12(4-2-3-10)5-6(7,8)9/h5H,2-4,10H2,1H3 |
| InChIKey | QQSVTKOMFNEXGN-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.61 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|