C26H31N2O7PS — CID 91370280
2-[7-[ethoxy(methyl)phosphoryl]oxy-1,1-dioxo-4H-1λ6,2,4-benzothiadiazin-3-yl]-4,4-dipropylnaphthalene-1,3-dione (PubChem CID 91370280) has the molecular formula C26H31N2O7PS and a molecular weight of 546.58 g/mol. Its IUPAC name is 2-[7-[ethoxy(methyl)phosphoryl]oxy-1,1-dioxo-4H-1λ6,2,4-benzothiadiazin-3-yl]-4,4-dipropylnaphthalene-1,3-dione.
| Compound Name | 2-[7-[ethoxy(methyl)phosphoryl]oxy-1,1-dioxo-4H-1λ6,2,4-benzothiadiazin-3-yl]-4,4-dipropylnaphthalene-1,3-dione |
|---|---|
| PubChem CID | 91370280 |
| Molecular Formula | C26H31N2O7PS |
| Molecular Weight | 546.58 g/mol |
| Exact Mass | 546.16 |
| IUPAC Name | 2-[7-[ethoxy(methyl)phosphoryl]oxy-1,1-dioxo-4H-1λ6,2,4-benzothiadiazin-3-yl]-4,4-dipropylnaphthalene-1,3-dione |
| SMILES | CCCC1(CCC)C(=O)C(C2=NS(=O)(=O)c3cc(OP(C)(=O)OCC)ccc3N2)C(=O)c2ccccc21 |
| InChI | InChI=1S/C26H31N2O7PS/c1-5-14-26(15-6-2)19-11-9-8-10-18(19)23(29)22(24(26)30)25-27-20-13-12-17(35-36(4,31)34-7-3)16-21(20)37(32,33)28-25/h8-13,16,22H,5-7,14-15H2,1-4H3,(H,27,28) |
| InChIKey | HOTDYZSHFOFXRT-UHFFFAOYSA-N |
| XLogP | 5.36 |
| TPSA | 128.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.58 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|