C39H68O9 — CID 91370304
3-[10-[6,10-dihydroxyundecan-2-yloxy(methoxy)methyl]-5-(4-methyl-2,5-dioxooxolan-3-yl)-4-tetracyclo[6.2.1.13,6.02,7]dodecanyl]-2,2-dimethylpropanoic acid;ethane (PubChem CID 91370304) has the molecular formula C39H68O9 and a molecular weight of 680.96 g/mol. Its IUPAC name is 3-[10-[6,10-dihydroxyundecan-2-yloxy(methoxy)methyl]-5-(4-methyl-2,5-dioxooxolan-3-yl)-4-tetracyclo[6.2.1.13,6.02,7]dodecanyl]-2,2-dimethylpropanoic acid;ethane.
| Compound Name | 3-[10-[6,10-dihydroxyundecan-2-yloxy(methoxy)methyl]-5-(4-methyl-2,5-dioxooxolan-3-yl)-4-tetracyclo[6.2.1.13,6.02,7]dodecanyl]-2,2-dimethylpropanoic acid;ethane |
|---|---|
| PubChem CID | 91370304 |
| Molecular Formula | C39H68O9 |
| Molecular Weight | 680.96 g/mol |
| Exact Mass | 680.49 |
| IUPAC Name | 3-[10-[6,10-dihydroxyundecan-2-yloxy(methoxy)methyl]-5-(4-methyl-2,5-dioxooxolan-3-yl)-4-tetracyclo[6.2.1.13,6.02,7]dodecanyl]-2,2-dimethylpropanoic acid;ethane |
| SMILES | CC.CC.COC(OC(C)CCCC(O)CCCC(C)O)C1CC2CC1C1C3CC(C(C4C(=O)OC(=O)C4C)C3CC(C)(C)C(=O)O)C21 |
| InChI | InChI=1S/C35H56O9.2C2H6/c1-17(36)9-7-11-21(37)12-8-10-18(2)43-33(42-6)24-14-20-13-22(24)29-23-15-25(28(20)29)30(26(23)16-35(4,5)34(40)41)27-19(3)31(38)44-32(27)39;2*1-2/h17-30,33,36-37H,7-16H2,1-6H3,(H,40,41);2*1-2H3 |
| InChIKey | XQCPOPITPQKPJF-UHFFFAOYSA-N |
| XLogP | 7.11 |
| TPSA | 139.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 680.96 |
| LogP ≤ 5 | 7.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'cyclooctane_1', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|