C19H24F6N4O — CID 91370336
1-[3-hydrazinylidene-4-(1,1,1-trifluorobutan-2-yl)piperazin-1-yl]-3-methyl-4-(2,4,5-trifluorophenyl)butan-1-one (PubChem CID 91370336) has the molecular formula C19H24F6N4O and a molecular weight of 438.42 g/mol. Its IUPAC name is 1-[3-hydrazinylidene-4-(1,1,1-trifluorobutan-2-yl)piperazin-1-yl]-3-methyl-4-(2,4,5-trifluorophenyl)butan-1-one.
| Compound Name | 1-[3-hydrazinylidene-4-(1,1,1-trifluorobutan-2-yl)piperazin-1-yl]-3-methyl-4-(2,4,5-trifluorophenyl)butan-1-one |
|---|---|
| PubChem CID | 91370336 |
| Molecular Formula | C19H24F6N4O |
| Molecular Weight | 438.42 g/mol |
| Exact Mass | 438.19 |
| IUPAC Name | 1-[3-hydrazinylidene-4-(1,1,1-trifluorobutan-2-yl)piperazin-1-yl]-3-methyl-4-(2,4,5-trifluorophenyl)butan-1-one |
| SMILES | CCC(N1CCN(C(=O)CC(C)Cc2cc(F)c(F)cc2F)CC1=NN)C(F)(F)F |
| InChI | InChI=1S/C19H24F6N4O/c1-3-16(19(23,24)25)29-5-4-28(10-17(29)27-26)18(30)7-11(2)6-12-8-14(21)15(22)9-13(12)20/h8-9,11,16H,3-7,10,26H2,1-2H3 |
| InChIKey | QJNWHCNJAUKGRE-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 61.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.42 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|