C20H26BFN3+ — CID 91371244
8,9-diethyl-5-fluoro-8,9,11-trimethyl-1,11-diaza-7-azonia-10-boratetracyclo[8.7.0.02,7.012,17]heptadeca-2(7),3,5,12,14,16-hexaene (PubChem CID 91371244) has the molecular formula C20H26BFN3+ and a molecular weight of 338.26 g/mol. Its IUPAC name is 8,9-diethyl-5-fluoro-8,9,11-trimethyl-1,11-diaza-7-azonia-10-boratetracyclo[8.7.0.02,7.012,17]heptadeca-2(7),3,5,12,14,16-hexaene.
| Compound Name | 8,9-diethyl-5-fluoro-8,9,11-trimethyl-1,11-diaza-7-azonia-10-boratetracyclo[8.7.0.02,7.012,17]heptadeca-2(7),3,5,12,14,16-hexaene |
|---|---|
| PubChem CID | 91371244 |
| Molecular Formula | C20H26BFN3+ |
| Molecular Weight | 338.26 g/mol |
| Exact Mass | 338.22 |
| IUPAC Name | 8,9-diethyl-5-fluoro-8,9,11-trimethyl-1,11-diaza-7-azonia-10-boratetracyclo[8.7.0.02,7.012,17]heptadeca-2(7),3,5,12,14,16-hexaene |
| SMILES | CCC1(C)B2N(C)c3ccccc3N2c2ccc(F)c[n+]2C1(C)CC |
| InChI | InChI=1S/C20H26BFN3/c1-6-19(3)20(4,7-2)24-14-15(22)12-13-18(24)25-17-11-9-8-10-16(17)23(5)21(19)25/h8-14H,6-7H2,1-5H3/q+1 |
| InChIKey | LIFSNZDGGQUBNN-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 10.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.26 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|