About 2-ethyl-6-(4-fluorophenyl)imino-1,3-benzoxazole-4,7-dione
2-ethyl-6-(4-fluorophenyl)imino-1,3-benzoxazole-4,7-dione (PubChem CID 91371698) has the molecular formula C15H11FN2O3
and a molecular weight of 286.26 g/mol. Its IUPAC name is 2-ethyl-6-(4-fluorophenyl)imino-1,3-benzoxazole-4,7-dione.
Molecular Properties
| Compound Name | 2-ethyl-6-(4-fluorophenyl)imino-1,3-benzoxazole-4,7-dione |
| PubChem CID | 91371698 |
| Molecular Formula | C15H11FN2O3 |
| Molecular Weight | 286.26 g/mol |
| Exact Mass | 286.08 |
| IUPAC Name | 2-ethyl-6-(4-fluorophenyl)imino-1,3-benzoxazole-4,7-dione |
| SMILES | CCc1nc2c(o1)C(=O)/C(=N/c1ccc(F)cc1)CC2=O |
| InChI | InChI=1S/C15H11FN2O3/c1-2-12-18-13-11(19)7-10(14(20)15(13)21-12)17-9-5-3-8(16)4-6-9/h3-6H,2,7H2,1H3/b17-10+ |
| InChIKey | WPSAGAXWGFBOLM-LICLKQGHSA-N |
| XLogP | 2.92 |
| TPSA | 72.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 286.26 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze 2-ethyl-6-(4-fluorophenyl)imino-1,3-benzoxazole-4,7-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-ethyl-6-(4-fluorophenyl)imino-1,3-benzoxazole-4,7-dione?
The IUPAC name of 2-ethyl-6-(4-fluorophenyl)imino-1,3-benzoxazole-4,7-dione (CID 91371698) is 2-ethyl-6-(4-fluorophenyl)imino-1,3-benzoxazole-4,7-dione.
What is the SMILES notation for 2-ethyl-6-(4-fluorophenyl)imino-1,3-benzoxazole-4,7-dione?
The canonical SMILES for 2-ethyl-6-(4-fluorophenyl)imino-1,3-benzoxazole-4,7-dione is CCc1nc2c(o1)C(=O)/C(=N/c1ccc(F)cc1)CC2=O.
What is the InChIKey of 2-ethyl-6-(4-fluorophenyl)imino-1,3-benzoxazole-4,7-dione?
The InChIKey is WPSAGAXWGFBOLM-LICLKQGHSA-N. The full InChI is InChI=1S/C15H11FN2O3/c1-2-12-18-13-11(19)7-10(14(20)15(13)21-12)17-9-5-3-8(16)4-6-9/h3-6H,2,7H2,1H3/b17-10+.
What are the key properties of 2-ethyl-6-(4-fluorophenyl)imino-1,3-benzoxazole-4,7-dione?
2-ethyl-6-(4-fluorophenyl)imino-1,3-benzoxazole-4,7-dione has a molecular weight of 286.26 g/mol, XLogP of 2.92, 2 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-ethyl-6-(4-fluorophenyl)imino-1,3-benzoxazole-4,7-dione is sourced from PubChem (CID 91371698), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).