About 2-[4-(4-methoxy-2,5-dimethylphenyl)buta-1,3-dienyl]pyridine
2-[4-(4-methoxy-2,5-dimethylphenyl)buta-1,3-dienyl]pyridine (PubChem CID 91371846) has the molecular formula C18H19NO
and a molecular weight of 265.36 g/mol. Its IUPAC name is 2-[4-(4-methoxy-2,5-dimethylphenyl)buta-1,3-dienyl]pyridine.
Molecular Properties
| Compound Name | 2-[4-(4-methoxy-2,5-dimethylphenyl)buta-1,3-dienyl]pyridine |
| PubChem CID | 91371846 |
| Molecular Formula | C18H19NO |
| Molecular Weight | 265.36 g/mol |
| Exact Mass | 265.15 |
| IUPAC Name | 2-[4-(4-methoxy-2,5-dimethylphenyl)buta-1,3-dienyl]pyridine |
| SMILES | COc1cc(C)c(C=CC=Cc2ccccn2)cc1C |
| InChI | InChI=1S/C18H19NO/c1-14-13-18(20-3)15(2)12-16(14)8-4-5-9-17-10-6-7-11-19-17/h4-13H,1-3H3 |
| InChIKey | TVJVMYWWCJPOOE-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 22.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 265.36 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze 2-[4-(4-methoxy-2,5-dimethylphenyl)buta-1,3-dienyl]pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[4-(4-methoxy-2,5-dimethylphenyl)buta-1,3-dienyl]pyridine?
The IUPAC name of 2-[4-(4-methoxy-2,5-dimethylphenyl)buta-1,3-dienyl]pyridine (CID 91371846) is 2-[4-(4-methoxy-2,5-dimethylphenyl)buta-1,3-dienyl]pyridine.
What is the SMILES notation for 2-[4-(4-methoxy-2,5-dimethylphenyl)buta-1,3-dienyl]pyridine?
The canonical SMILES for 2-[4-(4-methoxy-2,5-dimethylphenyl)buta-1,3-dienyl]pyridine is COc1cc(C)c(C=CC=Cc2ccccn2)cc1C.
What is the InChIKey of 2-[4-(4-methoxy-2,5-dimethylphenyl)buta-1,3-dienyl]pyridine?
The InChIKey is TVJVMYWWCJPOOE-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H19NO/c1-14-13-18(20-3)15(2)12-16(14)8-4-5-9-17-10-6-7-11-19-17/h4-13H,1-3H3.
What are the key properties of 2-[4-(4-methoxy-2,5-dimethylphenyl)buta-1,3-dienyl]pyridine?
2-[4-(4-methoxy-2,5-dimethylphenyl)buta-1,3-dienyl]pyridine has a molecular weight of 265.36 g/mol, XLogP of 4.43, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[4-(4-methoxy-2,5-dimethylphenyl)buta-1,3-dienyl]pyridine is sourced from PubChem (CID 91371846), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).