C24H16ClF7N8 — CID 91372367
4-N-[(6-chloro-3-pyridinyl)methyl]-2-N-[4-fluoro-3-(trifluoromethyl)phenyl]-6-[[3-(trifluoromethyl)phenyl]methyldiazenyl]-1,3,5-triazine-2,4-diamine (PubChem CID 91372367) has the molecular formula C24H16ClF7N8 and a molecular weight of 584.89 g/mol. Its IUPAC name is 4-N-[(6-chloro-3-pyridinyl)methyl]-2-N-[4-fluoro-3-(trifluoromethyl)phenyl]-6-[[3-(trifluoromethyl)phenyl]methyldiazenyl]-1,3,5-triazine-2,4-diamine.
| Compound Name | 4-N-[(6-chloro-3-pyridinyl)methyl]-2-N-[4-fluoro-3-(trifluoromethyl)phenyl]-6-[[3-(trifluoromethyl)phenyl]methyldiazenyl]-1,3,5-triazine-2,4-diamine |
|---|---|
| PubChem CID | 91372367 |
| Molecular Formula | C24H16ClF7N8 |
| Molecular Weight | 584.89 g/mol |
| Exact Mass | 584.11 |
| IUPAC Name | 4-N-[(6-chloro-3-pyridinyl)methyl]-2-N-[4-fluoro-3-(trifluoromethyl)phenyl]-6-[[3-(trifluoromethyl)phenyl]methyldiazenyl]-1,3,5-triazine-2,4-diamine |
| SMILES | Fc1ccc(Nc2nc(/N=N/Cc3cccc(C(F)(F)F)c3)nc(NCc3ccc(Cl)nc3)n2)cc1C(F)(F)F |
| InChI | InChI=1S/C24H16ClF7N8/c25-19-7-4-14(10-33-19)11-34-20-37-21(36-16-5-6-18(26)17(9-16)24(30,31)32)39-22(38-20)40-35-12-13-2-1-3-15(8-13)23(27,28)29/h1-10H,11-12H2,(H2,34,36,37,38,39)/b40-35+ |
| InChIKey | ZLUSZPARRFIOSG-JWVZJPBISA-N |
| XLogP | 7.74 |
| TPSA | 100.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 584.89 |
| LogP ≤ 5 | 7.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|