C13H16ClNO2S — CID 91372896
5-chloro-N-cyclohexylcyclohepta-1,3,4,6-tetraene-1-sulfonamide (PubChem CID 91372896) has the molecular formula C13H16ClNO2S and a molecular weight of 285.80 g/mol. Its IUPAC name is 5-chloro-N-cyclohexylcyclohepta-1,3,4,6-tetraene-1-sulfonamide.
| Compound Name | 5-chloro-N-cyclohexylcyclohepta-1,3,4,6-tetraene-1-sulfonamide |
|---|---|
| PubChem CID | 91372896 |
| Molecular Formula | C13H16ClNO2S |
| Molecular Weight | 285.80 g/mol |
| Exact Mass | 285.06 |
| IUPAC Name | 5-chloro-N-cyclohexylcyclohepta-1,3,4,6-tetraene-1-sulfonamide |
| SMILES | O=S(=O)(NC1CCCCC1)C1=CC=C=C(Cl)C=C1 |
| InChI | InChI=1S/C13H16ClNO2S/c14-11-5-4-8-13(10-9-11)18(16,17)15-12-6-2-1-3-7-12/h4,8-10,12,15H,1-3,6-7H2 |
| InChIKey | MQPCBXGDBZXQRY-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.80 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |