C25H26BrN5O5 — CID 91373028
2-[4-(3-bromo-4-methoxyphenoxy)-3,5-dimethylphenyl]-N-(5-cyanopentyl)-3,5-dioxo-1,2,4-triazine-6-carboxamide (PubChem CID 91373028) has the molecular formula C25H26BrN5O5 and a molecular weight of 556.42 g/mol. Its IUPAC name is 2-[4-(3-bromo-4-methoxyphenoxy)-3,5-dimethylphenyl]-N-(5-cyanopentyl)-3,5-dioxo-1,2,4-triazine-6-carboxamide.
| Compound Name | 2-[4-(3-bromo-4-methoxyphenoxy)-3,5-dimethylphenyl]-N-(5-cyanopentyl)-3,5-dioxo-1,2,4-triazine-6-carboxamide |
|---|---|
| PubChem CID | 91373028 |
| Molecular Formula | C25H26BrN5O5 |
| Molecular Weight | 556.42 g/mol |
| Exact Mass | 555.11 |
| IUPAC Name | 2-[4-(3-bromo-4-methoxyphenoxy)-3,5-dimethylphenyl]-N-(5-cyanopentyl)-3,5-dioxo-1,2,4-triazine-6-carboxamide |
| SMILES | COc1ccc(Oc2c(C)cc(-n3nc(C(=O)NCCCCCC#N)c(=O)[nH]c3=O)cc2C)cc1Br |
| InChI | InChI=1S/C25H26BrN5O5/c1-15-12-17(13-16(2)22(15)36-18-8-9-20(35-3)19(26)14-18)31-25(34)29-24(33)21(30-31)23(32)28-11-7-5-4-6-10-27/h8-9,12-14H,4-7,11H2,1-3H3,(H,28,32)(H,29,33,34) |
| InChIKey | XSDSUFIWHHLHSY-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 139.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.42 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|