C21H24F4N6O2 — CID 91373204
2-[[2-[[N-ethyl-C-(4-hydroxy-2-iminobutyl)carbonimidoyl]amino]-5-(trifluoromethyl)-4-pyridinyl]amino]-3-fluoro-N-methylbenzamide (PubChem CID 91373204) has the molecular formula C21H24F4N6O2 and a molecular weight of 468.46 g/mol. Its IUPAC name is 2-[[2-[[N-ethyl-C-(4-hydroxy-2-iminobutyl)carbonimidoyl]amino]-5-(trifluoromethyl)-4-pyridinyl]amino]-3-fluoro-N-methylbenzamide.
| Compound Name | 2-[[2-[[N-ethyl-C-(4-hydroxy-2-iminobutyl)carbonimidoyl]amino]-5-(trifluoromethyl)-4-pyridinyl]amino]-3-fluoro-N-methylbenzamide |
|---|---|
| PubChem CID | 91373204 |
| Molecular Formula | C21H24F4N6O2 |
| Molecular Weight | 468.46 g/mol |
| Exact Mass | 468.19 |
| IUPAC Name | 2-[[2-[[N-ethyl-C-(4-hydroxy-2-iminobutyl)carbonimidoyl]amino]-5-(trifluoromethyl)-4-pyridinyl]amino]-3-fluoro-N-methylbenzamide |
| SMILES | [H]/N=C(\CCO)C/C(=N\CC)Nc1cc(Nc2c(F)cccc2C(=O)NC)c(C(F)(F)F)cn1 |
| InChI | InChI=1S/C21H24F4N6O2/c1-3-28-17(9-12(26)7-8-32)31-18-10-16(14(11-29-18)21(23,24)25)30-19-13(20(33)27-2)5-4-6-15(19)22/h4-6,10-11,26,32H,3,7-9H2,1-2H3,(H,27,33)(H2,28,29,30,31)/b26-12+ |
| InChIKey | UDIADPCDOWUEHL-RPPGKUMJSA-N |
| XLogP | 3.97 |
| TPSA | 122.49 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.46 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|