About 2-(azet-2-yl)azete
2-(azet-2-yl)azete (PubChem CID 91373211) has the molecular formula C6H4N2
and a molecular weight of 104.11 g/mol. Its IUPAC name is 2-(azet-2-yl)azete.
Molecular Properties
| Compound Name | 2-(azet-2-yl)azete |
| PubChem CID | 91373211 |
| Molecular Formula | C6H4N2 |
| Molecular Weight | 104.11 g/mol |
| Exact Mass | 104.04 |
| IUPAC Name | 2-(azet-2-yl)azete |
| SMILES | C1=CC(C2=NC=C2)=N1 |
| InChI | InChI=1S/C6H4N2/c1-3-7-5(1)6-2-4-8-6/h1-4H |
| InChIKey | RPKZVEUNJSYSHC-UHFFFAOYSA-N |
| XLogP | 0.92 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 104.11 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-(azet-2-yl)azete with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(azet-2-yl)azete?
The IUPAC name of 2-(azet-2-yl)azete (CID 91373211) is 2-(azet-2-yl)azete.
What is the SMILES notation for 2-(azet-2-yl)azete?
The canonical SMILES for 2-(azet-2-yl)azete is C1=CC(C2=NC=C2)=N1.
What is the InChIKey of 2-(azet-2-yl)azete?
The InChIKey is RPKZVEUNJSYSHC-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H4N2/c1-3-7-5(1)6-2-4-8-6/h1-4H.
What are the key properties of 2-(azet-2-yl)azete?
2-(azet-2-yl)azete has a molecular weight of 104.11 g/mol, XLogP of 0.92, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(azet-2-yl)azete is sourced from PubChem (CID 91373211), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).