C9H3F13N2 — CID 91373212
1-(1,1,2,2,3,3,4,4,5,5,6,6,6-tridecafluorohexyl)imidazole (PubChem CID 91373212) has the molecular formula C9H3F13N2 and a molecular weight of 386.11 g/mol. Its IUPAC name is 1-(1,1,2,2,3,3,4,4,5,5,6,6,6-tridecafluorohexyl)imidazole.
| Compound Name | 1-(1,1,2,2,3,3,4,4,5,5,6,6,6-tridecafluorohexyl)imidazole |
|---|---|
| PubChem CID | 91373212 |
| Molecular Formula | C9H3F13N2 |
| Molecular Weight | 386.11 g/mol |
| Exact Mass | 386.01 |
| IUPAC Name | 1-(1,1,2,2,3,3,4,4,5,5,6,6,6-tridecafluorohexyl)imidazole |
| SMILES | FC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)n1ccnc1 |
| InChI | InChI=1S/C9H3F13N2/c10-4(11,6(14,15)8(18,19)20)5(12,13)7(16,17)9(21,22)24-2-1-23-3-24/h1-3H |
| InChIKey | MDNRPDOUXITICS-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.11 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|