About 4-(benzylideneamino)-N,N-diethylaniline
4-(benzylideneamino)-N,N-diethylaniline (PubChem CID 913738) has the molecular formula C17H20N2
and a molecular weight of 252.36 g/mol. Its IUPAC name is 4-(benzylideneamino)-N,N-diethylaniline.
Molecular Properties
| Compound Name | 4-(benzylideneamino)-N,N-diethylaniline |
| PubChem CID | 913738 |
| Molecular Formula | C17H20N2 |
| Molecular Weight | 252.36 g/mol |
| Exact Mass | 252.16 |
| IUPAC Name | 4-(benzylideneamino)-N,N-diethylaniline |
| SMILES | CCN(CC)c1ccc(/N=C/c2ccccc2)cc1 |
| InChI | InChI=1S/C17H20N2/c1-3-19(4-2)17-12-10-16(11-13-17)18-14-15-8-6-5-7-9-15/h5-14H,3-4H2,1-2H3/b18-14+ |
| InChIKey | FWDLETNGHFFARE-NBVRZTHBSA-N |
| XLogP | 4.28 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 252.36 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze 4-(benzylideneamino)-N,N-diethylaniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(benzylideneamino)-N,N-diethylaniline?
The IUPAC name of 4-(benzylideneamino)-N,N-diethylaniline (CID 913738) is 4-(benzylideneamino)-N,N-diethylaniline.
What is the SMILES notation for 4-(benzylideneamino)-N,N-diethylaniline?
The canonical SMILES for 4-(benzylideneamino)-N,N-diethylaniline is CCN(CC)c1ccc(/N=C/c2ccccc2)cc1.
What is the InChIKey of 4-(benzylideneamino)-N,N-diethylaniline?
The InChIKey is FWDLETNGHFFARE-NBVRZTHBSA-N. The full InChI is InChI=1S/C17H20N2/c1-3-19(4-2)17-12-10-16(11-13-17)18-14-15-8-6-5-7-9-15/h5-14H,3-4H2,1-2H3/b18-14+.
What are the key properties of 4-(benzylideneamino)-N,N-diethylaniline?
4-(benzylideneamino)-N,N-diethylaniline has a molecular weight of 252.36 g/mol, XLogP of 4.28, 5 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(benzylideneamino)-N,N-diethylaniline is sourced from PubChem (CID 913738), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).