About 11-diazobenzo[a]fluorene
11-diazobenzo[a]fluorene (PubChem CID 91374054) has the molecular formula C17H10N2
and a molecular weight of 242.28 g/mol. Its IUPAC name is 11-diazobenzo[a]fluorene.
Molecular Properties
| Compound Name | 11-diazobenzo[a]fluorene |
| PubChem CID | 91374054 |
| Molecular Formula | C17H10N2 |
| Molecular Weight | 242.28 g/mol |
| Exact Mass | 242.08 |
| IUPAC Name | 11-diazobenzo[a]fluorene |
| SMILES | [N-]=[N+]=C1c2ccccc2-c2ccc3ccccc3c21 |
| InChI | InChI=1S/C17H10N2/c18-19-17-15-8-4-3-7-13(15)14-10-9-11-5-1-2-6-12(11)16(14)17/h1-10H |
| InChIKey | LBLBDDHICCZKRZ-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 36.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 242.28 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|
Analyze 11-diazobenzo[a]fluorene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 11-diazobenzo[a]fluorene?
The IUPAC name of 11-diazobenzo[a]fluorene (CID 91374054) is 11-diazobenzo[a]fluorene.
What is the SMILES notation for 11-diazobenzo[a]fluorene?
The canonical SMILES for 11-diazobenzo[a]fluorene is [N-]=[N+]=C1c2ccccc2-c2ccc3ccccc3c21.
What is the InChIKey of 11-diazobenzo[a]fluorene?
The InChIKey is LBLBDDHICCZKRZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H10N2/c18-19-17-15-8-4-3-7-13(15)14-10-9-11-5-1-2-6-12(11)16(14)17/h1-10H.
What are the key properties of 11-diazobenzo[a]fluorene?
11-diazobenzo[a]fluorene has a molecular weight of 242.28 g/mol, XLogP of 3.89, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 11-diazobenzo[a]fluorene is sourced from PubChem (CID 91374054), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).