C8H11F5S — CID 91374313
3-ethyl-4,4,5,5,5-pentafluoro-1-methylsulfanylpent-2-ene (PubChem CID 91374313) has the molecular formula C8H11F5S and a molecular weight of 234.23 g/mol. Its IUPAC name is 3-ethyl-4,4,5,5,5-pentafluoro-1-methylsulfanylpent-2-ene.
| Compound Name | 3-ethyl-4,4,5,5,5-pentafluoro-1-methylsulfanylpent-2-ene |
|---|---|
| PubChem CID | 91374313 |
| Molecular Formula | C8H11F5S |
| Molecular Weight | 234.23 g/mol |
| Exact Mass | 234.05 |
| IUPAC Name | 3-ethyl-4,4,5,5,5-pentafluoro-1-methylsulfanylpent-2-ene |
| SMILES | CCC(=CCSC)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C8H11F5S/c1-3-6(4-5-14-2)7(9,10)8(11,12)13/h4H,3,5H2,1-2H3 |
| InChIKey | OJDLTZYUBVCGSN-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.23 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|