About [3-(2,3-dihydro-1H-inden-5-ylmethyl)-5-(trifluoromethyl)phenyl]methanol
[3-(2,3-dihydro-1H-inden-5-ylmethyl)-5-(trifluoromethyl)phenyl]methanol (PubChem CID 91375391) has the molecular formula C18H17F3O
and a molecular weight of 306.33 g/mol. Its IUPAC name is [3-(2,3-dihydro-1H-inden-5-ylmethyl)-5-(trifluoromethyl)phenyl]methanol.
Molecular Properties
| Compound Name | [3-(2,3-dihydro-1H-inden-5-ylmethyl)-5-(trifluoromethyl)phenyl]methanol |
| PubChem CID | 91375391 |
| Molecular Formula | C18H17F3O |
| Molecular Weight | 306.33 g/mol |
| Exact Mass | 306.12 |
| IUPAC Name | [3-(2,3-dihydro-1H-inden-5-ylmethyl)-5-(trifluoromethyl)phenyl]methanol |
| SMILES | OCc1cc(Cc2ccc3c(c2)CCC3)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C18H17F3O/c19-18(20,21)17-9-13(7-14(10-17)11-22)6-12-4-5-15-2-1-3-16(15)8-12/h4-5,7-10,22H,1-3,6,11H2 |
| InChIKey | NPDFHAHDCHESFB-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 306.33 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze [3-(2,3-dihydro-1H-inden-5-ylmethyl)-5-(trifluoromethyl)phenyl]methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [3-(2,3-dihydro-1H-inden-5-ylmethyl)-5-(trifluoromethyl)phenyl]methanol?
The IUPAC name of [3-(2,3-dihydro-1H-inden-5-ylmethyl)-5-(trifluoromethyl)phenyl]methanol (CID 91375391) is [3-(2,3-dihydro-1H-inden-5-ylmethyl)-5-(trifluoromethyl)phenyl]methanol.
What is the SMILES notation for [3-(2,3-dihydro-1H-inden-5-ylmethyl)-5-(trifluoromethyl)phenyl]methanol?
The canonical SMILES for [3-(2,3-dihydro-1H-inden-5-ylmethyl)-5-(trifluoromethyl)phenyl]methanol is OCc1cc(Cc2ccc3c(c2)CCC3)cc(C(F)(F)F)c1.
What is the InChIKey of [3-(2,3-dihydro-1H-inden-5-ylmethyl)-5-(trifluoromethyl)phenyl]methanol?
The InChIKey is NPDFHAHDCHESFB-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H17F3O/c19-18(20,21)17-9-13(7-14(10-17)11-22)6-12-4-5-15-2-1-3-16(15)8-12/h4-5,7-10,22H,1-3,6,11H2.
What are the key properties of [3-(2,3-dihydro-1H-inden-5-ylmethyl)-5-(trifluoromethyl)phenyl]methanol?
[3-(2,3-dihydro-1H-inden-5-ylmethyl)-5-(trifluoromethyl)phenyl]methanol has a molecular weight of 306.33 g/mol, XLogP of 4.28, 3 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for [3-(2,3-dihydro-1H-inden-5-ylmethyl)-5-(trifluoromethyl)phenyl]methanol is sourced from PubChem (CID 91375391), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).