About 5-[1-(methylamino)butylsulfanyl]pent-2-en-1-amine;propan-2-one
5-[1-(methylamino)butylsulfanyl]pent-2-en-1-amine;propan-2-one (PubChem CID 91375604) has the molecular formula C13H28N2OS
and a molecular weight of 260.45 g/mol. Its IUPAC name is 5-[1-(methylamino)butylsulfanyl]pent-2-en-1-amine;propan-2-one.
Molecular Properties
| Compound Name | 5-[1-(methylamino)butylsulfanyl]pent-2-en-1-amine;propan-2-one |
| PubChem CID | 91375604 |
| Molecular Formula | C13H28N2OS |
| Molecular Weight | 260.45 g/mol |
| Exact Mass | 260.19 |
| IUPAC Name | 5-[1-(methylamino)butylsulfanyl]pent-2-en-1-amine;propan-2-one |
| SMILES | CC(C)=O.CCCC(NC)SCCC=CCN |
| InChI | InChI=1S/C10H22N2S.C3H6O/c1-3-7-10(12-2)13-9-6-4-5-8-11;1-3(2)4/h4-5,10,12H,3,6-9,11H2,1-2H3;1-2H3 |
| InChIKey | GYQQCBDIZMPBMF-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 260.45 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 5-[1-(methylamino)butylsulfanyl]pent-2-en-1-amine;propan-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[1-(methylamino)butylsulfanyl]pent-2-en-1-amine;propan-2-one?
The IUPAC name of 5-[1-(methylamino)butylsulfanyl]pent-2-en-1-amine;propan-2-one (CID 91375604) is 5-[1-(methylamino)butylsulfanyl]pent-2-en-1-amine;propan-2-one.
What is the SMILES notation for 5-[1-(methylamino)butylsulfanyl]pent-2-en-1-amine;propan-2-one?
The canonical SMILES for 5-[1-(methylamino)butylsulfanyl]pent-2-en-1-amine;propan-2-one is CC(C)=O.CCCC(NC)SCCC=CCN.
What is the InChIKey of 5-[1-(methylamino)butylsulfanyl]pent-2-en-1-amine;propan-2-one?
The InChIKey is GYQQCBDIZMPBMF-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H22N2S.C3H6O/c1-3-7-10(12-2)13-9-6-4-5-8-11;1-3(2)4/h4-5,10,12H,3,6-9,11H2,1-2H3;1-2H3.
What are the key properties of 5-[1-(methylamino)butylsulfanyl]pent-2-en-1-amine;propan-2-one?
5-[1-(methylamino)butylsulfanyl]pent-2-en-1-amine;propan-2-one has a molecular weight of 260.45 g/mol, XLogP of 2.57, 8 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[1-(methylamino)butylsulfanyl]pent-2-en-1-amine;propan-2-one is sourced from PubChem (CID 91375604), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).