C42H20F10N6 — CID 91375721
5,15-bis(2,3,4,5,6-pentafluorophenyl)-10,20-dipyridin-4-yl-21,22,23,24-tetrahydroporphyrin (PubChem CID 91375721) has the molecular formula C42H20F10N6 and a molecular weight of 798.64 g/mol. Its IUPAC name is 5,15-bis(2,3,4,5,6-pentafluorophenyl)-10,20-dipyridin-4-yl-21,22,23,24-tetrahydroporphyrin.
| Compound Name | 5,15-bis(2,3,4,5,6-pentafluorophenyl)-10,20-dipyridin-4-yl-21,22,23,24-tetrahydroporphyrin |
|---|---|
| PubChem CID | 91375721 |
| Molecular Formula | C42H20F10N6 |
| Molecular Weight | 798.64 g/mol |
| Exact Mass | 798.16 |
| IUPAC Name | 5,15-bis(2,3,4,5,6-pentafluorophenyl)-10,20-dipyridin-4-yl-21,22,23,24-tetrahydroporphyrin |
| SMILES | Fc1c(F)c(F)c(C2=c3ccc([nH]3)=C(c3ccncc3)c3ccc([nH]3)C(c3c(F)c(F)c(F)c(F)c3F)=c3ccc([nH]3)=C(c3ccncc3)c3ccc2[nH]3)c(F)c1F |
| InChI | InChI=1S/C42H20F10N6/c43-33-31(34(44)38(48)41(51)37(33)47)29-23-5-1-19(55-23)27(17-9-13-53-14-10-17)20-2-6-25(56-20)30(32-35(45)39(49)42(52)40(50)36(32)46)26-8-4-22(58-26)28(18-11-15-54-16-12-18)21-3-7-24(29)57-21/h1-16,55-58H |
| InChIKey | QGKDPFOJDOPDLW-UHFFFAOYSA-N |
| XLogP | 6.48 |
| TPSA | 88.94 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 58 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 798.64 |
| LogP ≤ 5 | 6.48 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|