About dibutyl decanedioate;phosphorosomethane
dibutyl decanedioate;phosphorosomethane (PubChem CID 91376193) has the molecular formula C19H37O5P
and a molecular weight of 376.47 g/mol. Its IUPAC name is dibutyl decanedioate;phosphorosomethane.
Molecular Properties
| Compound Name | dibutyl decanedioate;phosphorosomethane |
| PubChem CID | 91376193 |
| Molecular Formula | C19H37O5P |
| Molecular Weight | 376.47 g/mol |
| Exact Mass | 376.24 |
| IUPAC Name | dibutyl decanedioate;phosphorosomethane |
| SMILES | CCCCOC(=O)CCCCCCCCC(=O)OCCCC.CP=O |
| InChI | InChI=1S/C18H34O4.CH3OP/c1-3-5-15-21-17(19)13-11-9-7-8-10-12-14-18(20)22-16-6-4-2;1-3-2/h3-16H2,1-2H3;1H3 |
| InChIKey | BYXMIEKSUZDRAH-UHFFFAOYSA-N |
| XLogP | 5.70 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 376.47 |
| LogP ≤ 5 | 5.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze dibutyl decanedioate;phosphorosomethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dibutyl decanedioate;phosphorosomethane?
The IUPAC name of dibutyl decanedioate;phosphorosomethane (CID 91376193) is dibutyl decanedioate;phosphorosomethane.
What is the SMILES notation for dibutyl decanedioate;phosphorosomethane?
The canonical SMILES for dibutyl decanedioate;phosphorosomethane is CCCCOC(=O)CCCCCCCCC(=O)OCCCC.CP=O.
What is the InChIKey of dibutyl decanedioate;phosphorosomethane?
The InChIKey is BYXMIEKSUZDRAH-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H34O4.CH3OP/c1-3-5-15-21-17(19)13-11-9-7-8-10-12-14-18(20)22-16-6-4-2;1-3-2/h3-16H2,1-2H3;1H3.
What are the key properties of dibutyl decanedioate;phosphorosomethane?
dibutyl decanedioate;phosphorosomethane has a molecular weight of 376.47 g/mol, XLogP of 5.70, 15 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for dibutyl decanedioate;phosphorosomethane is sourced from PubChem (CID 91376193), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).