C27H21Cl2N3O3 — CID 91376472
2,4-dichloro-5-methoxy-3-(7-methoxy-8-phenylmethoxybenzo[g]quinazolin-4-yl)aniline (PubChem CID 91376472) has the molecular formula C27H21Cl2N3O3 and a molecular weight of 506.39 g/mol. Its IUPAC name is 2,4-dichloro-5-methoxy-3-(7-methoxy-8-phenylmethoxybenzo[g]quinazolin-4-yl)aniline.
| Compound Name | 2,4-dichloro-5-methoxy-3-(7-methoxy-8-phenylmethoxybenzo[g]quinazolin-4-yl)aniline |
|---|---|
| PubChem CID | 91376472 |
| Molecular Formula | C27H21Cl2N3O3 |
| Molecular Weight | 506.39 g/mol |
| Exact Mass | 505.10 |
| IUPAC Name | 2,4-dichloro-5-methoxy-3-(7-methoxy-8-phenylmethoxybenzo[g]quinazolin-4-yl)aniline |
| SMILES | COc1cc2cc3c(-c4c(Cl)c(N)cc(OC)c4Cl)ncnc3cc2cc1OCc1ccccc1 |
| InChI | InChI=1S/C27H21Cl2N3O3/c1-33-21-10-16-8-18-20(9-17(16)11-22(21)35-13-15-6-4-3-5-7-15)31-14-32-27(18)24-25(28)19(30)12-23(34-2)26(24)29/h3-12,14H,13,30H2,1-2H3 |
| InChIKey | DRWLLGIGEIDZOW-UHFFFAOYSA-N |
| XLogP | 6.94 |
| TPSA | 79.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.39 |
| LogP ≤ 5 | 6.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|