C16H12F6N2O10S2 — CID 91376668
[3,5,9,11-tetrahydroxy-10-(2,2,2-trifluoroethylsulfonyloxy)-4,10-diazatetracyclo[5.5.2.02,6.08,12]tetradeca-2,5,8,11,13-pentaen-4-yl] 2,2,2-trifluoroethanesulfonate (PubChem CID 91376668) has the molecular formula C16H12F6N2O10S2 and a molecular weight of 570.40 g/mol. Its IUPAC name is [3,5,9,11-tetrahydroxy-10-(2,2,2-trifluoroethylsulfonyloxy)-4,10-diazatetracyclo[5.5.2.02,6.08,12]tetradeca-2,5,8,11,13-pentaen-4-yl] 2,2,2-trifluoroethanesulfonate.
| Compound Name | [3,5,9,11-tetrahydroxy-10-(2,2,2-trifluoroethylsulfonyloxy)-4,10-diazatetracyclo[5.5.2.02,6.08,12]tetradeca-2,5,8,11,13-pentaen-4-yl] 2,2,2-trifluoroethanesulfonate |
|---|---|
| PubChem CID | 91376668 |
| Molecular Formula | C16H12F6N2O10S2 |
| Molecular Weight | 570.40 g/mol |
| Exact Mass | 569.98 |
| IUPAC Name | [3,5,9,11-tetrahydroxy-10-(2,2,2-trifluoroethylsulfonyloxy)-4,10-diazatetracyclo[5.5.2.02,6.08,12]tetradeca-2,5,8,11,13-pentaen-4-yl] 2,2,2-trifluoroethanesulfonate |
| SMILES | O=S(=O)(CC(F)(F)F)On1c(O)c2c(c1O)C1C=CC2c2c1c(O)n(OS(=O)(=O)CC(F)(F)F)c2O |
| InChI | InChI=1S/C16H12F6N2O10S2/c17-15(18,19)3-35(29,30)33-23-11(25)7-5-1-2-6(9(7)13(23)27)10-8(5)12(26)24(14(10)28)34-36(31,32)4-16(20,21)22/h1-2,5-6,25-28H,3-4H2 |
| InChIKey | WWGYUBXXQDHWRQ-UHFFFAOYSA-N |
| XLogP | 0.90 |
| TPSA | 177.52 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 570.40 |
| LogP ≤ 5 | 0.90 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|