C37H44N4O6 — CID 91376860
methyl (17S,18S)-12-ethenyl-7-ethyl-20-(2-methoxy-2-oxoethyl)-18-(3-methoxy-3-oxopropyl)-3,8,13,17-tetramethyl-17,18,21,22,23,24-hexahydroporphyrin-2-carboxylate (PubChem CID 91376860) has the molecular formula C37H44N4O6 and a molecular weight of 640.78 g/mol. Its IUPAC name is methyl (17S,18S)-12-ethenyl-7-ethyl-20-(2-methoxy-2-oxoethyl)-18-(3-methoxy-3-oxopropyl)-3,8,13,17-tetramethyl-17,18,21,22,23,24-hexahydroporphyrin-2-carboxylate.
| Compound Name | methyl (17S,18S)-12-ethenyl-7-ethyl-20-(2-methoxy-2-oxoethyl)-18-(3-methoxy-3-oxopropyl)-3,8,13,17-tetramethyl-17,18,21,22,23,24-hexahydroporphyrin-2-carboxylate |
|---|---|
| PubChem CID | 91376860 |
| Molecular Formula | C37H44N4O6 |
| Molecular Weight | 640.78 g/mol |
| Exact Mass | 640.33 |
| IUPAC Name | methyl (17S,18S)-12-ethenyl-7-ethyl-20-(2-methoxy-2-oxoethyl)-18-(3-methoxy-3-oxopropyl)-3,8,13,17-tetramethyl-17,18,21,22,23,24-hexahydroporphyrin-2-carboxylate |
| SMILES | C=Cc1c2[nH]c(c1C)C=C1NC(=C(CC(=O)OC)c3[nH]c(c(C)c3C(=O)OC)C=c3[nH]c(c(C)c3CC)=C2)[C@@H](CCC(=O)OC)[C@@H]1C |
| InChI | InChI=1S/C37H44N4O6/c1-10-22-18(3)26-15-28-20(5)24(12-13-32(42)45-7)35(40-28)25(14-33(43)46-8)36-34(37(44)47-9)21(6)29(41-36)17-31-23(11-2)19(4)27(39-31)16-30(22)38-26/h10,15-17,20,24,38-41H,1,11-14H2,2-9H3/t20-,24-/m0/s1 |
| InChIKey | BWXMUPQLGAUKIX-RDPSFJRHSA-N |
| XLogP | 4.68 |
| TPSA | 138.30 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 47 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 640.78 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|