C12H26N2O3Si — CID 91377049
2-trimethylsilylethyl (3S,4S)-4-amino-3-hydroxy-3-methylpiperidine-1-carboxylate (PubChem CID 91377049) has the molecular formula C12H26N2O3Si and a molecular weight of 274.44 g/mol. Its IUPAC name is 2-trimethylsilylethyl (3S,4S)-4-amino-3-hydroxy-3-methylpiperidine-1-carboxylate.
| Compound Name | 2-trimethylsilylethyl (3S,4S)-4-amino-3-hydroxy-3-methylpiperidine-1-carboxylate |
|---|---|
| PubChem CID | 91377049 |
| Molecular Formula | C12H26N2O3Si |
| Molecular Weight | 274.44 g/mol |
| Exact Mass | 274.17 |
| IUPAC Name | 2-trimethylsilylethyl (3S,4S)-4-amino-3-hydroxy-3-methylpiperidine-1-carboxylate |
| SMILES | C[C@]1(O)CN(C(=O)OCC[Si](C)(C)C)CC[C@@H]1N |
| InChI | InChI=1S/C12H26N2O3Si/c1-12(16)9-14(6-5-10(12)13)11(15)17-7-8-18(2,3)4/h10,16H,5-9,13H2,1-4H3/t10-,12-/m0/s1 |
| InChIKey | JYWZAZFCLXKRKG-JQWIXIFHSA-N |
| XLogP | 1.25 |
| TPSA | 75.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.44 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|