About 2-(hydroxymethyl)-1,3,5-oxadiazin-4-one
2-(hydroxymethyl)-1,3,5-oxadiazin-4-one (PubChem CID 91377164) has the molecular formula C4H4N2O3
and a molecular weight of 128.09 g/mol. Its IUPAC name is 2-(hydroxymethyl)-1,3,5-oxadiazin-4-one.
Molecular Properties
| Compound Name | 2-(hydroxymethyl)-1,3,5-oxadiazin-4-one |
| PubChem CID | 91377164 |
| Molecular Formula | C4H4N2O3 |
| Molecular Weight | 128.09 g/mol |
| Exact Mass | 128.02 |
| IUPAC Name | 2-(hydroxymethyl)-1,3,5-oxadiazin-4-one |
| SMILES | O=c1ncoc(CO)n1 |
| InChI | InChI=1S/C4H4N2O3/c7-1-3-6-4(8)5-2-9-3/h2,7H,1H2 |
| InChIKey | NJPXOXTVWKGECM-UHFFFAOYSA-N |
| XLogP | -1.08 |
| TPSA | 76.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 128.09 |
| LogP ≤ 5 | -1.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-(hydroxymethyl)-1,3,5-oxadiazin-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(hydroxymethyl)-1,3,5-oxadiazin-4-one?
The IUPAC name of 2-(hydroxymethyl)-1,3,5-oxadiazin-4-one (CID 91377164) is 2-(hydroxymethyl)-1,3,5-oxadiazin-4-one.
What is the SMILES notation for 2-(hydroxymethyl)-1,3,5-oxadiazin-4-one?
The canonical SMILES for 2-(hydroxymethyl)-1,3,5-oxadiazin-4-one is O=c1ncoc(CO)n1.
What is the InChIKey of 2-(hydroxymethyl)-1,3,5-oxadiazin-4-one?
The InChIKey is NJPXOXTVWKGECM-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H4N2O3/c7-1-3-6-4(8)5-2-9-3/h2,7H,1H2.
What are the key properties of 2-(hydroxymethyl)-1,3,5-oxadiazin-4-one?
2-(hydroxymethyl)-1,3,5-oxadiazin-4-one has a molecular weight of 128.09 g/mol, XLogP of -1.08, 1 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(hydroxymethyl)-1,3,5-oxadiazin-4-one is sourced from PubChem (CID 91377164), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).