About methyl 2-(2-ethyl-1,3-oxazol-4-yl)-4-methyl-5H-1,3-oxazole-4-carboxylate
methyl 2-(2-ethyl-1,3-oxazol-4-yl)-4-methyl-5H-1,3-oxazole-4-carboxylate (PubChem CID 91377504) has the molecular formula C11H14N2O4
and a molecular weight of 238.24 g/mol. Its IUPAC name is methyl 2-(2-ethyl-1,3-oxazol-4-yl)-4-methyl-5H-1,3-oxazole-4-carboxylate.
Molecular Properties
| Compound Name | methyl 2-(2-ethyl-1,3-oxazol-4-yl)-4-methyl-5H-1,3-oxazole-4-carboxylate |
| PubChem CID | 91377504 |
| Molecular Formula | C11H14N2O4 |
| Molecular Weight | 238.24 g/mol |
| Exact Mass | 238.10 |
| IUPAC Name | methyl 2-(2-ethyl-1,3-oxazol-4-yl)-4-methyl-5H-1,3-oxazole-4-carboxylate |
| SMILES | CCc1nc(C2=NC(C)(C(=O)OC)CO2)co1 |
| InChI | InChI=1S/C11H14N2O4/c1-4-8-12-7(5-16-8)9-13-11(2,6-17-9)10(14)15-3/h5H,4,6H2,1-3H3 |
| InChIKey | WUSBHTBZMKFIQH-UHFFFAOYSA-N |
| XLogP | 0.95 |
| TPSA | 73.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 238.24 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze methyl 2-(2-ethyl-1,3-oxazol-4-yl)-4-methyl-5H-1,3-oxazole-4-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 2-(2-ethyl-1,3-oxazol-4-yl)-4-methyl-5H-1,3-oxazole-4-carboxylate?
The IUPAC name of methyl 2-(2-ethyl-1,3-oxazol-4-yl)-4-methyl-5H-1,3-oxazole-4-carboxylate (CID 91377504) is methyl 2-(2-ethyl-1,3-oxazol-4-yl)-4-methyl-5H-1,3-oxazole-4-carboxylate.
What is the SMILES notation for methyl 2-(2-ethyl-1,3-oxazol-4-yl)-4-methyl-5H-1,3-oxazole-4-carboxylate?
The canonical SMILES for methyl 2-(2-ethyl-1,3-oxazol-4-yl)-4-methyl-5H-1,3-oxazole-4-carboxylate is CCc1nc(C2=NC(C)(C(=O)OC)CO2)co1.
What is the InChIKey of methyl 2-(2-ethyl-1,3-oxazol-4-yl)-4-methyl-5H-1,3-oxazole-4-carboxylate?
The InChIKey is WUSBHTBZMKFIQH-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H14N2O4/c1-4-8-12-7(5-16-8)9-13-11(2,6-17-9)10(14)15-3/h5H,4,6H2,1-3H3.
What are the key properties of methyl 2-(2-ethyl-1,3-oxazol-4-yl)-4-methyl-5H-1,3-oxazole-4-carboxylate?
methyl 2-(2-ethyl-1,3-oxazol-4-yl)-4-methyl-5H-1,3-oxazole-4-carboxylate has a molecular weight of 238.24 g/mol, XLogP of 0.95, 3 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-(2-ethyl-1,3-oxazol-4-yl)-4-methyl-5H-1,3-oxazole-4-carboxylate is sourced from PubChem (CID 91377504), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).