C23H45N7 — CID 91377987
6-piperazin-1-yl-2-N,4-N-bis(2,4,4-trimethylpentan-2-yl)-1,3,5-triazine-2,4-diamine (PubChem CID 91377987) has the molecular formula C23H45N7 and a molecular weight of 419.66 g/mol. Its IUPAC name is 6-piperazin-1-yl-2-N,4-N-bis(2,4,4-trimethylpentan-2-yl)-1,3,5-triazine-2,4-diamine.
| Compound Name | 6-piperazin-1-yl-2-N,4-N-bis(2,4,4-trimethylpentan-2-yl)-1,3,5-triazine-2,4-diamine |
|---|---|
| PubChem CID | 91377987 |
| Molecular Formula | C23H45N7 |
| Molecular Weight | 419.66 g/mol |
| Exact Mass | 419.37 |
| IUPAC Name | 6-piperazin-1-yl-2-N,4-N-bis(2,4,4-trimethylpentan-2-yl)-1,3,5-triazine-2,4-diamine |
| SMILES | CC(C)(C)CC(C)(C)Nc1nc(NC(C)(C)CC(C)(C)C)nc(N2CCNCC2)n1 |
| InChI | InChI=1S/C23H45N7/c1-20(2,3)15-22(7,8)28-17-25-18(29-23(9,10)16-21(4,5)6)27-19(26-17)30-13-11-24-12-14-30/h24H,11-16H2,1-10H3,(H2,25,26,27,28,29) |
| InChIKey | BBVRNUBOQIBWRH-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 78.00 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.66 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |