About 1-[5,6-dimethyl-4-(trifluoromethyl)cyclohexa-1,3-dien-1-yl]pyrrolidine
1-[5,6-dimethyl-4-(trifluoromethyl)cyclohexa-1,3-dien-1-yl]pyrrolidine (PubChem CID 91378151) has the molecular formula C13H18F3N
and a molecular weight of 245.29 g/mol. Its IUPAC name is 1-[5,6-dimethyl-4-(trifluoromethyl)cyclohexa-1,3-dien-1-yl]pyrrolidine.
Molecular Properties
| Compound Name | 1-[5,6-dimethyl-4-(trifluoromethyl)cyclohexa-1,3-dien-1-yl]pyrrolidine |
| PubChem CID | 91378151 |
| Molecular Formula | C13H18F3N |
| Molecular Weight | 245.29 g/mol |
| Exact Mass | 245.14 |
| IUPAC Name | 1-[5,6-dimethyl-4-(trifluoromethyl)cyclohexa-1,3-dien-1-yl]pyrrolidine |
| SMILES | CC1C(N2CCCC2)=CC=C(C(F)(F)F)C1C |
| InChI | InChI=1S/C13H18F3N/c1-9-10(2)12(17-7-3-4-8-17)6-5-11(9)13(14,15)16/h5-6,9-10H,3-4,7-8H2,1-2H3 |
| InChIKey | IMTASYMFUYMSRR-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 245.29 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 1-[5,6-dimethyl-4-(trifluoromethyl)cyclohexa-1,3-dien-1-yl]pyrrolidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[5,6-dimethyl-4-(trifluoromethyl)cyclohexa-1,3-dien-1-yl]pyrrolidine?
The IUPAC name of 1-[5,6-dimethyl-4-(trifluoromethyl)cyclohexa-1,3-dien-1-yl]pyrrolidine (CID 91378151) is 1-[5,6-dimethyl-4-(trifluoromethyl)cyclohexa-1,3-dien-1-yl]pyrrolidine.
What is the SMILES notation for 1-[5,6-dimethyl-4-(trifluoromethyl)cyclohexa-1,3-dien-1-yl]pyrrolidine?
The canonical SMILES for 1-[5,6-dimethyl-4-(trifluoromethyl)cyclohexa-1,3-dien-1-yl]pyrrolidine is CC1C(N2CCCC2)=CC=C(C(F)(F)F)C1C.
What is the InChIKey of 1-[5,6-dimethyl-4-(trifluoromethyl)cyclohexa-1,3-dien-1-yl]pyrrolidine?
The InChIKey is IMTASYMFUYMSRR-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H18F3N/c1-9-10(2)12(17-7-3-4-8-17)6-5-11(9)13(14,15)16/h5-6,9-10H,3-4,7-8H2,1-2H3.
What are the key properties of 1-[5,6-dimethyl-4-(trifluoromethyl)cyclohexa-1,3-dien-1-yl]pyrrolidine?
1-[5,6-dimethyl-4-(trifluoromethyl)cyclohexa-1,3-dien-1-yl]pyrrolidine has a molecular weight of 245.29 g/mol, XLogP of 3.74, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[5,6-dimethyl-4-(trifluoromethyl)cyclohexa-1,3-dien-1-yl]pyrrolidine is sourced from PubChem (CID 91378151), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).