C34H52O12 — CID 91378268
2-[2-(2,2-dimethylbutanoyloxy)ethoxycarbonyl]cyclohexene-1-carboxylic acid;ethane;3-[2-(2-methylbutanoyloxy)ethoxycarbonyl]bicyclo[2.2.1]hept-5-ene-2-carboxylic acid (PubChem CID 91378268) has the molecular formula C34H52O12 and a molecular weight of 652.78 g/mol. Its IUPAC name is 2-[2-(2,2-dimethylbutanoyloxy)ethoxycarbonyl]cyclohexene-1-carboxylic acid;ethane;3-[2-(2-methylbutanoyloxy)ethoxycarbonyl]bicyclo[2.2.1]hept-5-ene-2-carboxylic acid.
| Compound Name | 2-[2-(2,2-dimethylbutanoyloxy)ethoxycarbonyl]cyclohexene-1-carboxylic acid;ethane;3-[2-(2-methylbutanoyloxy)ethoxycarbonyl]bicyclo[2.2.1]hept-5-ene-2-carboxylic acid |
|---|---|
| PubChem CID | 91378268 |
| Molecular Formula | C34H52O12 |
| Molecular Weight | 652.78 g/mol |
| Exact Mass | 652.35 |
| IUPAC Name | 2-[2-(2,2-dimethylbutanoyloxy)ethoxycarbonyl]cyclohexene-1-carboxylic acid;ethane;3-[2-(2-methylbutanoyloxy)ethoxycarbonyl]bicyclo[2.2.1]hept-5-ene-2-carboxylic acid |
| SMILES | CC.CCC(C)(C)C(=O)OCCOC(=O)C1=C(C(=O)O)CCCC1.CCC(C)C(=O)OCCOC(=O)C1C2C=CC(C2)C1C(=O)O |
| InChI | InChI=1S/C16H22O6.C16H24O6.C2H6/c1-3-9(2)15(19)21-6-7-22-16(20)13-11-5-4-10(8-11)12(13)14(17)18;1-4-16(2,3)15(20)22-10-9-21-14(19)12-8-6-5-7-11(12)13(17)18;1-2/h4-5,9-13H,3,6-8H2,1-2H3,(H,17,18);4-10H2,1-3H3,(H,17,18);1-2H3 |
| InChIKey | IFWVNTXPXUGNSZ-UHFFFAOYSA-N |
| XLogP | 5.13 |
| TPSA | 179.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 652.78 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|