C33H33F3NO2+ — CID 91378283
7'-(4-butylphenyl)-2',2'-diethyl-5'-(trifluoromethyl)spiro[1-azoniatetracyclo[10.2.1.05,14.08,13]pentadeca-1,3,5(14),6,8(13),9,11-heptaene-15,3'-5H-1,4-dioxepine] (PubChem CID 91378283) has the molecular formula C33H33F3NO2+ and a molecular weight of 532.63 g/mol. Its IUPAC name is 7'-(4-butylphenyl)-2',2'-diethyl-5'-(trifluoromethyl)spiro[1-azoniatetracyclo[10.2.1.05,14.08,13]pentadeca-1,3,5(14),6,8(13),9,11-heptaene-15,3'-5H-1,4-dioxepine].
| Compound Name | 7'-(4-butylphenyl)-2',2'-diethyl-5'-(trifluoromethyl)spiro[1-azoniatetracyclo[10.2.1.05,14.08,13]pentadeca-1,3,5(14),6,8(13),9,11-heptaene-15,3'-5H-1,4-dioxepine] |
|---|---|
| PubChem CID | 91378283 |
| Molecular Formula | C33H33F3NO2+ |
| Molecular Weight | 532.63 g/mol |
| Exact Mass | 532.25 |
| IUPAC Name | 7'-(4-butylphenyl)-2',2'-diethyl-5'-(trifluoromethyl)spiro[1-azoniatetracyclo[10.2.1.05,14.08,13]pentadeca-1,3,5(14),6,8(13),9,11-heptaene-15,3'-5H-1,4-dioxepine] |
| SMILES | CCCCc1ccc(C2=CC(C(F)(F)F)OC3(c4cccc5ccc6ccc[n+]3c6c45)C(CC)(CC)O2)cc1 |
| InChI | InChI=1S/C33H33F3NO2/c1-4-7-10-22-14-16-23(17-15-22)27-21-28(33(34,35)36)39-32(31(5-2,6-3)38-27)26-13-8-11-24-18-19-25-12-9-20-37(32)30(25)29(24)26/h8-9,11-21,28H,4-7,10H2,1-3H3/q+1 |
| InChIKey | LOFYUIDRIHWZPP-UHFFFAOYSA-N |
| XLogP | 8.22 |
| TPSA | 22.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.63 |
| LogP ≤ 5 | 8.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|