About ethane;1,3,3-trimethyl-4H-isoquinoline
ethane;1,3,3-trimethyl-4H-isoquinoline (PubChem CID 91378568) has the molecular formula C14H21N
and a molecular weight of 203.33 g/mol. Its IUPAC name is ethane;1,3,3-trimethyl-4H-isoquinoline.
Molecular Properties
| Compound Name | ethane;1,3,3-trimethyl-4H-isoquinoline |
| PubChem CID | 91378568 |
| Molecular Formula | C14H21N |
| Molecular Weight | 203.33 g/mol |
| Exact Mass | 203.17 |
| IUPAC Name | ethane;1,3,3-trimethyl-4H-isoquinoline |
| SMILES | CC.CC1=NC(C)(C)Cc2ccccc21 |
| InChI | InChI=1S/C12H15N.C2H6/c1-9-11-7-5-4-6-10(11)8-12(2,3)13-9;1-2/h4-7H,8H2,1-3H3;1-2H3 |
| InChIKey | HAIIWBAVNILVRR-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 203.33 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze ethane;1,3,3-trimethyl-4H-isoquinoline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;1,3,3-trimethyl-4H-isoquinoline?
The IUPAC name of ethane;1,3,3-trimethyl-4H-isoquinoline (CID 91378568) is ethane;1,3,3-trimethyl-4H-isoquinoline.
What is the SMILES notation for ethane;1,3,3-trimethyl-4H-isoquinoline?
The canonical SMILES for ethane;1,3,3-trimethyl-4H-isoquinoline is CC.CC1=NC(C)(C)Cc2ccccc21.
What is the InChIKey of ethane;1,3,3-trimethyl-4H-isoquinoline?
The InChIKey is HAIIWBAVNILVRR-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H15N.C2H6/c1-9-11-7-5-4-6-10(11)8-12(2,3)13-9;1-2/h4-7H,8H2,1-3H3;1-2H3.
What are the key properties of ethane;1,3,3-trimethyl-4H-isoquinoline?
ethane;1,3,3-trimethyl-4H-isoquinoline has a molecular weight of 203.33 g/mol, XLogP of 3.86, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;1,3,3-trimethyl-4H-isoquinoline is sourced from PubChem (CID 91378568), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).