C27H26ClF4N5O3 — CID 91378600
4-[4-[(5-chloro-2-ethoxyphenyl)carbamoylamino]phenyl]-N-[2-fluoro-6-(trifluoromethyl)phenyl]piperazine-1-carboxamide (PubChem CID 91378600) has the molecular formula C27H26ClF4N5O3 and a molecular weight of 579.98 g/mol. Its IUPAC name is 4-[4-[(5-chloro-2-ethoxyphenyl)carbamoylamino]phenyl]-N-[2-fluoro-6-(trifluoromethyl)phenyl]piperazine-1-carboxamide.
| Compound Name | 4-[4-[(5-chloro-2-ethoxyphenyl)carbamoylamino]phenyl]-N-[2-fluoro-6-(trifluoromethyl)phenyl]piperazine-1-carboxamide |
|---|---|
| PubChem CID | 91378600 |
| Molecular Formula | C27H26ClF4N5O3 |
| Molecular Weight | 579.98 g/mol |
| Exact Mass | 579.17 |
| IUPAC Name | 4-[4-[(5-chloro-2-ethoxyphenyl)carbamoylamino]phenyl]-N-[2-fluoro-6-(trifluoromethyl)phenyl]piperazine-1-carboxamide |
| SMILES | CCOc1ccc(Cl)cc1NC(=O)Nc1ccc(N2CCN(C(=O)Nc3c(F)cccc3C(F)(F)F)CC2)cc1 |
| InChI | InChI=1S/C27H26ClF4N5O3/c1-2-40-23-11-6-17(28)16-22(23)34-25(38)33-18-7-9-19(10-8-18)36-12-14-37(15-13-36)26(39)35-24-20(27(30,31)32)4-3-5-21(24)29/h3-11,16H,2,12-15H2,1H3,(H,35,39)(H2,33,34,38) |
| InChIKey | YYMQPGLZYOOXQI-UHFFFAOYSA-N |
| XLogP | 6.89 |
| TPSA | 85.94 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 579.98 |
| LogP ≤ 5 | 6.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|