About (2R,3R)-1-azido-2,3-dimethylheptadec-5-ene
(2R,3R)-1-azido-2,3-dimethylheptadec-5-ene (PubChem CID 91378632) has the molecular formula C19H37N3
and a molecular weight of 307.53 g/mol. Its IUPAC name is (2R,3R)-1-azido-2,3-dimethylheptadec-5-ene.
Molecular Properties
| Compound Name | (2R,3R)-1-azido-2,3-dimethylheptadec-5-ene |
| PubChem CID | 91378632 |
| Molecular Formula | C19H37N3 |
| Molecular Weight | 307.53 g/mol |
| Exact Mass | 307.30 |
| IUPAC Name | (2R,3R)-1-azido-2,3-dimethylheptadec-5-ene |
| SMILES | CCCCCCCCCCCC=CC[C@@H](C)[C@@H](C)CN=[N+]=[N-] |
| InChI | InChI=1S/C19H37N3/c1-4-5-6-7-8-9-10-11-12-13-14-15-16-18(2)19(3)17-21-22-20/h14-15,18-19H,4-13,16-17H2,1-3H3/t18-,19+/m1/s1 |
| InChIKey | VIMOKFALRLEDRG-MOPGFXCFSA-N |
| XLogP | 7.44 |
| TPSA | 48.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 307.53 |
| LogP ≤ 5 | 7.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (2R,3R)-1-azido-2,3-dimethylheptadec-5-ene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2R,3R)-1-azido-2,3-dimethylheptadec-5-ene?
The IUPAC name of (2R,3R)-1-azido-2,3-dimethylheptadec-5-ene (CID 91378632) is (2R,3R)-1-azido-2,3-dimethylheptadec-5-ene.
What is the SMILES notation for (2R,3R)-1-azido-2,3-dimethylheptadec-5-ene?
The canonical SMILES for (2R,3R)-1-azido-2,3-dimethylheptadec-5-ene is CCCCCCCCCCCC=CC[C@@H](C)[C@@H](C)CN=[N+]=[N-].
What is the InChIKey of (2R,3R)-1-azido-2,3-dimethylheptadec-5-ene?
The InChIKey is VIMOKFALRLEDRG-MOPGFXCFSA-N. The full InChI is InChI=1S/C19H37N3/c1-4-5-6-7-8-9-10-11-12-13-14-15-16-18(2)19(3)17-21-22-20/h14-15,18-19H,4-13,16-17H2,1-3H3/t18-,19+/m1/s1.
What are the key properties of (2R,3R)-1-azido-2,3-dimethylheptadec-5-ene?
(2R,3R)-1-azido-2,3-dimethylheptadec-5-ene has a molecular weight of 307.53 g/mol, XLogP of 7.44, 15 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (2R,3R)-1-azido-2,3-dimethylheptadec-5-ene is sourced from PubChem (CID 91378632), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).