About 8-bromo-9-fluoro-2,3-dimethyl-5-(4-methylpiperazin-1-yl)-3H-pyrimido[1,2-a]quinoxaline
8-bromo-9-fluoro-2,3-dimethyl-5-(4-methylpiperazin-1-yl)-3H-pyrimido[1,2-a]quinoxaline (PubChem CID 91378649) has the molecular formula C18H21BrFN5
and a molecular weight of 406.30 g/mol. Its IUPAC name is 8-bromo-9-fluoro-2,3-dimethyl-5-(4-methylpiperazin-1-yl)-3H-pyrimido[1,2-a]quinoxaline.
Molecular Properties
| Compound Name | 8-bromo-9-fluoro-2,3-dimethyl-5-(4-methylpiperazin-1-yl)-3H-pyrimido[1,2-a]quinoxaline |
| PubChem CID | 91378649 |
| Molecular Formula | C18H21BrFN5 |
| Molecular Weight | 406.30 g/mol |
| Exact Mass | 405.10 |
| IUPAC Name | 8-bromo-9-fluoro-2,3-dimethyl-5-(4-methylpiperazin-1-yl)-3H-pyrimido[1,2-a]quinoxaline |
| SMILES | CC1=CN2C(=NC1C)C(N1CCN(C)CC1)=Nc1cc(Br)c(F)cc12 |
| InChI | InChI=1S/C18H21BrFN5/c1-11-10-25-16-9-14(20)13(19)8-15(16)22-17(18(25)21-12(11)2)24-6-4-23(3)5-7-24/h8-10,12H,4-7H2,1-3H3 |
| InChIKey | KPZRIXSVHKDCKH-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 34.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 406.30 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 8-bromo-9-fluoro-2,3-dimethyl-5-(4-methylpiperazin-1-yl)-3H-pyrimido[1,2-a]quinoxaline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-bromo-9-fluoro-2,3-dimethyl-5-(4-methylpiperazin-1-yl)-3H-pyrimido[1,2-a]quinoxaline?
The IUPAC name of 8-bromo-9-fluoro-2,3-dimethyl-5-(4-methylpiperazin-1-yl)-3H-pyrimido[1,2-a]quinoxaline (CID 91378649) is 8-bromo-9-fluoro-2,3-dimethyl-5-(4-methylpiperazin-1-yl)-3H-pyrimido[1,2-a]quinoxaline.
What is the SMILES notation for 8-bromo-9-fluoro-2,3-dimethyl-5-(4-methylpiperazin-1-yl)-3H-pyrimido[1,2-a]quinoxaline?
The canonical SMILES for 8-bromo-9-fluoro-2,3-dimethyl-5-(4-methylpiperazin-1-yl)-3H-pyrimido[1,2-a]quinoxaline is CC1=CN2C(=NC1C)C(N1CCN(C)CC1)=Nc1cc(Br)c(F)cc12.
What is the InChIKey of 8-bromo-9-fluoro-2,3-dimethyl-5-(4-methylpiperazin-1-yl)-3H-pyrimido[1,2-a]quinoxaline?
The InChIKey is KPZRIXSVHKDCKH-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H21BrFN5/c1-11-10-25-16-9-14(20)13(19)8-15(16)22-17(18(25)21-12(11)2)24-6-4-23(3)5-7-24/h8-10,12H,4-7H2,1-3H3.
What are the key properties of 8-bromo-9-fluoro-2,3-dimethyl-5-(4-methylpiperazin-1-yl)-3H-pyrimido[1,2-a]quinoxaline?
8-bromo-9-fluoro-2,3-dimethyl-5-(4-methylpiperazin-1-yl)-3H-pyrimido[1,2-a]quinoxaline has a molecular weight of 406.30 g/mol, XLogP of 3.39, 0 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 8-bromo-9-fluoro-2,3-dimethyl-5-(4-methylpiperazin-1-yl)-3H-pyrimido[1,2-a]quinoxaline is sourced from PubChem (CID 91378649), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).