About 4-anilino-7,7-dimethyl-2-phenyl-6,8-dihydroquinazolin-5-one
4-anilino-7,7-dimethyl-2-phenyl-6,8-dihydroquinazolin-5-one (PubChem CID 91378745) has the molecular formula C22H21N3O
and a molecular weight of 343.43 g/mol. Its IUPAC name is 4-anilino-7,7-dimethyl-2-phenyl-6,8-dihydroquinazolin-5-one.
Molecular Properties
| Compound Name | 4-anilino-7,7-dimethyl-2-phenyl-6,8-dihydroquinazolin-5-one |
| PubChem CID | 91378745 |
| Molecular Formula | C22H21N3O |
| Molecular Weight | 343.43 g/mol |
| Exact Mass | 343.17 |
| IUPAC Name | 4-anilino-7,7-dimethyl-2-phenyl-6,8-dihydroquinazolin-5-one |
| SMILES | CC1(C)CC(=O)c2c(nc(-c3ccccc3)nc2Nc2ccccc2)C1 |
| InChI | InChI=1S/C22H21N3O/c1-22(2)13-17-19(18(26)14-22)21(23-16-11-7-4-8-12-16)25-20(24-17)15-9-5-3-6-10-15/h3-12H,13-14H2,1-2H3,(H,23,24,25) |
| InChIKey | NHBWTFZBIJZGPM-UHFFFAOYSA-N |
| XLogP | 5.04 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 343.43 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4-anilino-7,7-dimethyl-2-phenyl-6,8-dihydroquinazolin-5-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-anilino-7,7-dimethyl-2-phenyl-6,8-dihydroquinazolin-5-one?
The IUPAC name of 4-anilino-7,7-dimethyl-2-phenyl-6,8-dihydroquinazolin-5-one (CID 91378745) is 4-anilino-7,7-dimethyl-2-phenyl-6,8-dihydroquinazolin-5-one.
What is the SMILES notation for 4-anilino-7,7-dimethyl-2-phenyl-6,8-dihydroquinazolin-5-one?
The canonical SMILES for 4-anilino-7,7-dimethyl-2-phenyl-6,8-dihydroquinazolin-5-one is CC1(C)CC(=O)c2c(nc(-c3ccccc3)nc2Nc2ccccc2)C1.
What is the InChIKey of 4-anilino-7,7-dimethyl-2-phenyl-6,8-dihydroquinazolin-5-one?
The InChIKey is NHBWTFZBIJZGPM-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H21N3O/c1-22(2)13-17-19(18(26)14-22)21(23-16-11-7-4-8-12-16)25-20(24-17)15-9-5-3-6-10-15/h3-12H,13-14H2,1-2H3,(H,23,24,25).
What are the key properties of 4-anilino-7,7-dimethyl-2-phenyl-6,8-dihydroquinazolin-5-one?
4-anilino-7,7-dimethyl-2-phenyl-6,8-dihydroquinazolin-5-one has a molecular weight of 343.43 g/mol, XLogP of 5.04, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-anilino-7,7-dimethyl-2-phenyl-6,8-dihydroquinazolin-5-one is sourced from PubChem (CID 91378745), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).