(4R)-4-fluoro-2-methylpyrrolidine-1-carboxylic acid

C6H10FNO2 — CID 91379404

IUPAC(4R)-4-fluoro-2-methylpyrrolidine-1-carboxylic acid
SMILESCC1C[C@@H](F)CN1C(=O)O
InChIInChI=1S/C6H10FNO2/c1-4-2-5(7)3-8(4)6(9)10/h4-5H,2-3H2,1H3,(H,9,10)/t4?,5-/m1/s1
InChIKeyOMILYTLOWBESEB-BRJRFNKRSA-N
MW147.15 g/mol
LogP1.10
Rot. Bonds

About (4R)-4-fluoro-2-methylpyrrolidine-1-carboxylic acid

(4R)-4-fluoro-2-methylpyrrolidine-1-carboxylic acid (PubChem CID 91379404) has the molecular formula C6H10FNO2 and a molecular weight of 147.15 g/mol. Its IUPAC name is (4R)-4-fluoro-2-methylpyrrolidine-1-carboxylic acid.

Molecular Properties

Compound Name(4R)-4-fluoro-2-methylpyrrolidine-1-carboxylic acid
PubChem CID91379404
Molecular FormulaC6H10FNO2
Molecular Weight147.15 g/mol
Exact Mass147.07
IUPAC Name(4R)-4-fluoro-2-methylpyrrolidine-1-carboxylic acid
SMILESCC1C[C@@H](F)CN1C(=O)O
InChIInChI=1S/C6H10FNO2/c1-4-2-5(7)3-8(4)6(9)10/h4-5H,2-3H2,1H3,(H,9,10)/t4?,5-/m1/s1
InChIKeyOMILYTLOWBESEB-BRJRFNKRSA-N
XLogP1.10
TPSA40.54 Ų
H-Bond Donors1
H-Bond Acceptors1
Rotatable Bonds
Heavy Atoms10
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500147.15
LogP ≤ 51.10
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 101

Analyze (4R)-4-fluoro-2-methylpyrrolidine-1-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of (4R)-4-fluoro-2-methylpyrrolidine-1-carboxylic acid?
The IUPAC name of (4R)-4-fluoro-2-methylpyrrolidine-1-carboxylic acid (CID 91379404) is (4R)-4-fluoro-2-methylpyrrolidine-1-carboxylic acid.
What is the SMILES notation for (4R)-4-fluoro-2-methylpyrrolidine-1-carboxylic acid?
The canonical SMILES for (4R)-4-fluoro-2-methylpyrrolidine-1-carboxylic acid is CC1C[C@@H](F)CN1C(=O)O.
What is the InChIKey of (4R)-4-fluoro-2-methylpyrrolidine-1-carboxylic acid?
The InChIKey is OMILYTLOWBESEB-BRJRFNKRSA-N. The full InChI is InChI=1S/C6H10FNO2/c1-4-2-5(7)3-8(4)6(9)10/h4-5H,2-3H2,1H3,(H,9,10)/t4?,5-/m1/s1.
What are the key properties of (4R)-4-fluoro-2-methylpyrrolidine-1-carboxylic acid?
(4R)-4-fluoro-2-methylpyrrolidine-1-carboxylic acid has a molecular weight of 147.15 g/mol, XLogP of 1.10, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (4R)-4-fluoro-2-methylpyrrolidine-1-carboxylic acid is sourced from PubChem (CID 91379404), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).