C7H11N3 — CID 91379562
1,2,3,3a,4,5,6,6a-octahydropyrrolo[3,4-c]pyrrole-4-carbonitrile (PubChem CID 91379562) has the molecular formula C7H11N3 and a molecular weight of 137.19 g/mol. Its IUPAC name is 1,2,3,3a,4,5,6,6a-octahydropyrrolo[3,4-c]pyrrole-4-carbonitrile.
| Compound Name | 1,2,3,3a,4,5,6,6a-octahydropyrrolo[3,4-c]pyrrole-4-carbonitrile |
|---|---|
| PubChem CID | 91379562 |
| Molecular Formula | C7H11N3 |
| Molecular Weight | 137.19 g/mol |
| Exact Mass | 137.10 |
| IUPAC Name | 1,2,3,3a,4,5,6,6a-octahydropyrrolo[3,4-c]pyrrole-4-carbonitrile |
| SMILES | N#CC1NCC2CNCC21 |
| InChI | InChI=1S/C7H11N3/c8-1-7-6-4-9-2-5(6)3-10-7/h5-7,9-10H,2-4H2 |
| InChIKey | ODUOMHBXBKQMNP-UHFFFAOYSA-N |
| XLogP | -0.68 |
| TPSA | 47.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 137.19 |
| LogP ≤ 5 | -0.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |