C24H34O2 — CID 91379815
(8S,10S,13R,14S,17S)-17-ethyl-2-hydroxy-10,13-dimethyl-7-prop-2-enyl-1,2,6,7,8,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-3-one (PubChem CID 91379815) has the molecular formula C24H34O2 and a molecular weight of 354.53 g/mol. Its IUPAC name is (8S,10S,13R,14S,17S)-17-ethyl-2-hydroxy-10,13-dimethyl-7-prop-2-enyl-1,2,6,7,8,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-3-one.
| Compound Name | (8S,10S,13R,14S,17S)-17-ethyl-2-hydroxy-10,13-dimethyl-7-prop-2-enyl-1,2,6,7,8,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-3-one |
|---|---|
| PubChem CID | 91379815 |
| Molecular Formula | C24H34O2 |
| Molecular Weight | 354.53 g/mol |
| Exact Mass | 354.26 |
| IUPAC Name | (8S,10S,13R,14S,17S)-17-ethyl-2-hydroxy-10,13-dimethyl-7-prop-2-enyl-1,2,6,7,8,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-3-one |
| SMILES | C=CCC1CC2=CC(=O)C(O)C[C@]2(C)C2=CC[C@]3(C)[C@@H](CC)CC[C@H]3[C@@H]21 |
| InChI | InChI=1S/C24H34O2/c1-5-7-15-12-17-13-20(25)21(26)14-24(17,4)19-10-11-23(3)16(6-2)8-9-18(23)22(15)19/h5,10,13,15-16,18,21-22,26H,1,6-9,11-12,14H2,2-4H3/t15?,16-,18-,21?,22-,23+,24-/m0/s1 |
| InChIKey | YRLPYPXIGXGDNU-NKQIZNGNSA-N |
| XLogP | 5.24 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.53 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|