About 5-bromo-3-methoxy-1,2-dimethyl-3H-isoquinoline
5-bromo-3-methoxy-1,2-dimethyl-3H-isoquinoline (PubChem CID 91379978) has the molecular formula C12H14BrNO
and a molecular weight of 268.15 g/mol. Its IUPAC name is 5-bromo-3-methoxy-1,2-dimethyl-3H-isoquinoline.
Molecular Properties
| Compound Name | 5-bromo-3-methoxy-1,2-dimethyl-3H-isoquinoline |
| PubChem CID | 91379978 |
| Molecular Formula | C12H14BrNO |
| Molecular Weight | 268.15 g/mol |
| Exact Mass | 267.03 |
| IUPAC Name | 5-bromo-3-methoxy-1,2-dimethyl-3H-isoquinoline |
| SMILES | COC1C=c2c(Br)cccc2=C(C)N1C |
| InChI | InChI=1S/C12H14BrNO/c1-8-9-5-4-6-11(13)10(9)7-12(15-3)14(8)2/h4-7,12H,1-3H3 |
| InChIKey | ZWKLCEKZCBQEDP-UHFFFAOYSA-N |
| XLogP | 1.28 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 268.15 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 5-bromo-3-methoxy-1,2-dimethyl-3H-isoquinoline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-bromo-3-methoxy-1,2-dimethyl-3H-isoquinoline?
The IUPAC name of 5-bromo-3-methoxy-1,2-dimethyl-3H-isoquinoline (CID 91379978) is 5-bromo-3-methoxy-1,2-dimethyl-3H-isoquinoline.
What is the SMILES notation for 5-bromo-3-methoxy-1,2-dimethyl-3H-isoquinoline?
The canonical SMILES for 5-bromo-3-methoxy-1,2-dimethyl-3H-isoquinoline is COC1C=c2c(Br)cccc2=C(C)N1C.
What is the InChIKey of 5-bromo-3-methoxy-1,2-dimethyl-3H-isoquinoline?
The InChIKey is ZWKLCEKZCBQEDP-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H14BrNO/c1-8-9-5-4-6-11(13)10(9)7-12(15-3)14(8)2/h4-7,12H,1-3H3.
What are the key properties of 5-bromo-3-methoxy-1,2-dimethyl-3H-isoquinoline?
5-bromo-3-methoxy-1,2-dimethyl-3H-isoquinoline has a molecular weight of 268.15 g/mol, XLogP of 1.28, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-bromo-3-methoxy-1,2-dimethyl-3H-isoquinoline is sourced from PubChem (CID 91379978), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).