C10H14O6S3 — CID 91380016
5-methyl-1,2,3-tris(methylsulfonyl)benzene (PubChem CID 91380016) has the molecular formula C10H14O6S3 and a molecular weight of 326.42 g/mol. Its IUPAC name is 5-methyl-1,2,3-tris(methylsulfonyl)benzene.
| Compound Name | 5-methyl-1,2,3-tris(methylsulfonyl)benzene |
|---|---|
| PubChem CID | 91380016 |
| Molecular Formula | C10H14O6S3 |
| Molecular Weight | 326.42 g/mol |
| Exact Mass | 326.00 |
| IUPAC Name | 5-methyl-1,2,3-tris(methylsulfonyl)benzene |
| SMILES | Cc1cc(S(C)(=O)=O)c(S(C)(=O)=O)c(S(C)(=O)=O)c1 |
| InChI | InChI=1S/C10H14O6S3/c1-7-5-8(17(2,11)12)10(19(4,15)16)9(6-7)18(3,13)14/h5-6H,1-4H3 |
| InChIKey | DXFRRKNYOOXNLO-UHFFFAOYSA-N |
| XLogP | 0.21 |
| TPSA | 102.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.42 |
| LogP ≤ 5 | 0.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |