C35H48FNO5 — CID 91380203
4-ethoxy-N-[5-[(13S)-11-fluoro-3,17-dihydroxy-13-methyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-7-yl]pentyl]-N-(2-methoxyethyl)benzamide (PubChem CID 91380203) has the molecular formula C35H48FNO5 and a molecular weight of 581.77 g/mol. Its IUPAC name is 4-ethoxy-N-[5-[(13S)-11-fluoro-3,17-dihydroxy-13-methyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-7-yl]pentyl]-N-(2-methoxyethyl)benzamide.
| Compound Name | 4-ethoxy-N-[5-[(13S)-11-fluoro-3,17-dihydroxy-13-methyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-7-yl]pentyl]-N-(2-methoxyethyl)benzamide |
|---|---|
| PubChem CID | 91380203 |
| Molecular Formula | C35H48FNO5 |
| Molecular Weight | 581.77 g/mol |
| Exact Mass | 581.35 |
| IUPAC Name | 4-ethoxy-N-[5-[(13S)-11-fluoro-3,17-dihydroxy-13-methyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-7-yl]pentyl]-N-(2-methoxyethyl)benzamide |
| SMILES | CCOc1ccc(C(=O)N(CCCCCC2Cc3cc(O)ccc3C3C(F)C[C@]4(C)C(O)CCC4C23)CCOC)cc1 |
| InChI | InChI=1S/C35H48FNO5/c1-4-42-27-12-9-23(10-13-27)34(40)37(18-19-41-3)17-7-5-6-8-24-20-25-21-26(38)11-14-28(25)33-30(36)22-35(2)29(32(24)33)15-16-31(35)39/h9-14,21,24,29-33,38-39H,4-8,15-20,22H2,1-3H3/t24?,29?,30?,31?,32?,33?,35-/m0/s1 |
| InChIKey | UMSHTSYAWYHYTP-PJBTVZKJSA-N |
| XLogP | 6.53 |
| TPSA | 79.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 581.77 |
| LogP ≤ 5 | 6.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|